Feedback

4-chlorobenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1459Image of MNXM1459
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 0
formulaC7H4ClO2
charge-1
mass155.55816
referencechebi:17861
InChIKeyXRHGYUZYPHTUJZ-UHFFFAOYSA-M
InChIInChI=1S/C7H5ClO2/c8-6-3-1-5(2-4-6)7(9)10/h1-4H,(H,9,10)/p-1
SMILES[O-]C(=O)c1ccc(Cl)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17861
chebi:17861
4-chlorobenzoate
p-chlorobenzoate
pCl-benzoate anion
envipath:...ea60a6ec84df
envipathM:...ea60a6ec84df
4-Chlorobenzoate
sabiork.compound:6167
sabiorkM:6167
kegg.compound:C02370
keggC:C02370
4-Chlorobenzoate
4-Chlorobenzoic acid
seed.compound:cpd01582
seedM:cpd01582
4-Chlorobenzoate
4-Chlorobenzoic acid
4-chlorobenzoate
metacyc.compound:CPD-615
metacycM:CPD-615
4-chlorobenzoate
4-Chlorobenzoic acid
CHEBI:30747
chebi:30747
4-chlorobenzoic acid
4-CHLORO-BENZOIC ACID
4-Chlorobenzoic acid
p-chlorbenzoic acid
p-chlorobenzoic acid
envipath:...185f5293072a
envipathM:...185f5293072a
S3 (4-chlorobenzoic acid)
4-Chlorobenzoic acid;PC-1-1
envipath:...5e833b20b546
envipathM:...5e833b20b546
compound 1002
envipath:...3ad3141f7f2d
envipathM:...3ad3141f7f2d
compound 38461
chebi:11973
chebi:1803
chebi:20333
chebi:20334
chebi:49369
keggC:M_C02370
seedM:M_cpd01582
secondary/obsolete/fantasy identifier