Feedback

chloroacetate

PropertiesImageOccurences in reactions
MNX_IDMNXM1468Image of MNXM1468
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 2
formulaC2H2ClO2
charge-1
mass92.97488
referencechebi:23123
InChIKeyFOCAUTSVDIKZOP-UHFFFAOYSA-M
InChIInChI=1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5)/p-1
SMILESO=C([O-])CCl
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:23123
chebi:23123
chloroacetate
Chloroacetic acid ion(1-)
chloroacetate anion
chloroacetate(1-)
mono-chloroacetate
monochloroacetate anion
monochloroacetic acid anion
lipidmaps:LMFA01090068
lipidmapsM:LMFA01090068
2-chloro-acetic acid
2-chloro-ethanoic acid
metacyc.compound:CHLOROACETIC-ACID
metacycM:CHLOROACETIC-ACID
2-chloroacetate
chloroacetate
chloroacetic acid
envipath:...260ab3632f0a
envipathM:...260ab3632f0a
Chloroacetate
hmdb:HMDB0031331 Chloroacetic acid
2-Chloro-acetate
2-Chloro-acetic acid
2-Chloro-ethanoate
2-Chloro-ethanoic acid
2-Chloroacetate
2-Chloroacetic acid
2-chloroacetic acid
Acetocaustin
Acide chloracetique
Acide chloroacetique
Acide monochloracetique
Acidomonocloroacetico
CAA
CH2ClCOOH
Chloracetate
Chloracetic acid
Chloroacetate
Chloroacetic
Chloroacetic acid (80% or less)
Chloroacetic acid crystalline
Chloroacetic acid, acs
Chloroacetic acid, aluminum salt
Chloroacetic acid, ammonium (2:1) salt
Chloroacetic acid, ammonium salt
Chloroacetic acid, calcium (3:1) salt
Chloroacetic acid, calcium salt
Chloroacetic acid, liquid
Chloroacetic acid, molten
Chloroacetic acid, potassium (2:1) salt
Chloroacetic acid, potassium salt
Chloroacetic acid, silver salt
Chloroacetic acid, sodium (2:1) salt
Chloroacetic acid, sodium (5:2) salt
Chloroacetic acid, sodium salt
Chloroacetic acid, solid
Chloroacetic acid, solid (dot)
Chloroacetic-acid
Chloroethanoate
Chloroethanoic acid
MCA
Monochloorazijnzuur
Monochloracetic acid
Monochloracetic acidacide monochloracetique
Monochloressigsaeure
Monochloroacetate
Monochloroacetic acid
Monochloroethanoate
Monochloroethanoic acid
SODIUM chloroacetATE
Sjphlqdiktp@
a-Chloro-acetate
a-Chloro-acetic acid
alpha-Chloro-acetate
alpha-Chloro-acetic acid
alpha-Chloroacetic acid
alpha-chloro-acetate
alpha-chloro-acetic acid
chloro-Acetic acid
chloroacetic acid
seed.compound:cpd04135
seedM:cpd04135
Chloroacetic acid
2-chloroacetate
Chloroethanoic acid
chloroacetate
chloroacetic acid
kegg.drug:D07677
keggD:D07677
Chloroacetic acid
Acetocaustin (TN)
sabiork.compound:2917
sabiorkM:2917
Chloroacetic acid
Chloroacetate
Chloroethanoic acid
kegg.compound:C06755
keggC:C06755
Chloroacetic acid
Chloroethanoic acid
CHEBI:27869
chebi:27869
chloroacetic acid
2-chloro-acetic acid
2-chloro-ethanoic acid
2-chloroacetic acid
Acide chloracetique
Acide chloroacetique
Acide monochloracetique
CAA
Chloroacetic acid
Chloroethanoic acid
Monochloressigsaeure
alpha-chloro-acetic acid
chloracetic acid
monochloroacetic acid
monochloroethanoic acid
envipath:...ea20a7146db8
envipathM:...ea20a7146db8
compound 39893
hmdb:HMDB31331
chebi:23125
chebi:3622
keggC:M_C06755
keggD:M_D07677
seedM:M_cpd04135
secondary/obsolete/fantasy identifier