Feedback

chloroacetate

Properties
MNX_IDMNXM1468
formulaC2H2ClO2
charge-1
mass93.48878
referencechebi:23123
Image of MNXM1468
InChIKeyFOCAUTSVDIKZOP-UHFFFAOYSA-M
InChIInChI=1S/C2H3ClO2/c3-1-2(4)5/h1H2,(H,4,5)/p-1
SMILES[O-]C(=O)CCl

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref12
Distinct compatimentalized reactions in models1

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:2917 Chloroacetic acid
Chloroacetate
Chloroethanoic acid
chebi:27869 chloroacetic acid
2-chloro-acetic acid
2-chloro-ethanoic acid
2-chloroacetic acid
Acide chloracetique
Acide chloroacetique
Acide monochloracetique
CAA
Chloroacetic acid
Chloroethanoic acid
Monochloressigsaeure
alpha-chloro-acetic acid
chloracetic acid
monochloroacetic acid
monochloroethanoic acid
chebi:23123 chloroacetate
Chloroacetic acid ion(1-)
chloroacetate anion
chloroacetate(1-)
mono-chloroacetate
monochloroacetate anion
monochloroacetic acid anion
lipidmaps:LMFA01090068 2-chloro-acetic acid
2-chloro-ethanoic acid
hmdb:HMDB0031331 Chloroacetic acid
2-Chloroacetate
2-Chloroacetic acid
2-chloro-Acetate
2-chloro-Acetic acid
2-chloro-Ethanoate
2-chloro-Ethanoic acid
2-chloroacetic acid
Acetocaustin
Acide chloracetique
Acide chloroacetique
Acide monochloracetique
Acidomonocloroacetico
CAA
CH2ClCOOH
Chloracetate
Chloracetic acid
Chloroacetate
Chloroacetic
Chloroacetic acid (80% or less)
Chloroacetic acid crystalline
Chloroacetic acid, acs
Chloroacetic acid, aluminum salt
Chloroacetic acid, ammonium (2:1) salt
Chloroacetic acid, ammonium salt
Chloroacetic acid, calcium (3:1) salt
Chloroacetic acid, calcium salt
Chloroacetic acid, liquid
Chloroacetic acid, molten
Chloroacetic acid, potassium (2:1) salt
Chloroacetic acid, potassium salt
Chloroacetic acid, silver salt
Chloroacetic acid, sodium (2:1) salt
Chloroacetic acid, sodium (5:2) salt
Chloroacetic acid, sodium salt
Chloroacetic acid, solid
Chloroacetic acid, solid (dot)
Chloroacetic-acid
Chloroethanoate
Chloroethanoic acid
MCA
Monochloorazijnzuur
Monochloracetic acid
Monochloracetic acidacide monochloracetique
Monochloressigsaeure
Monochloroacetate
Monochloroacetic acid
Monochloroethanoate
Monochloroethanoic acid
SODIUM chloroacetATE
Sjphlqdiktp@
a-chloro-Acetate
a-chloro-Acetic acid
alpha-Chloroacetic acid
alpha-chloro-Acetate
alpha-chloro-Acetic acid
alpha-chloro-acetate
alpha-chloro-acetic acid
chloro-Acetic acid
chloroacetic acid
keggC:C06755 Chloroacetic acid
Chloroethanoic acid
metacycM:CHLOROACETIC-ACID 2-chloroacetate
chloroacetate
chloroacetic acid
seedM:cpd04135 Chloroacetic acid
2-chloroacetate
Chloroethanoic acid
chloroacetate
chloroacetic acid
envipath:...260ab3632f0a Chloroacetate
envipath:...ea20a7146db8 compound 39893
chebi:23125
chebi:3622
hmdb:HMDB31331
keggC:M_C06755
keggD:M_D07677
seedM:M_cpd04135
secondary/obsolete/fantasy identifier
keggD:D07677 Chloroacetic acid
Acetocaustin (TN)
MNXM724121is deprecated and replaced by this entry