Feedback

fluoroacetate

PropertiesImageOccurences in reactions
MNX_IDMNXM1475Image of MNXM1475
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC2H2FO2
charge-1
mass77.00443
referencechebi:18172
InChIKeyQEWYKACRFQMRMB-UHFFFAOYSA-M
InChIInChI=1S/C2H3FO2/c3-1-2(4)5/h1H2,(H,4,5)/p-1
SMILESO=C([O-])CF
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:18172
chebi:18172
fluoroacetate
FCH2CO2 anion
fluoroacetic acid, ion(1-)
envipath:...8178d13ef245
envipathM:...8178d13ef245
Fluoroacetate
sabiork.compound:8396
sabiorkM:8396
kegg.compound:C06108
keggC:C06108
Fluoroacetate
Cymonic acid
Fluoroacetic acid
Gifblaar poison
HFA
UN 2642
seed.compound:cpd03644
seedM:cpd03644
HFA
Cymonic acid
Fluoroacetate
Fluoroacetic acid
Gifblaar poison
UN 2642
fluoroacetate
metacyc.compound:CPD-12709
metacycM:CPD-12709
fluoroacetate
CHEBI:30775
chebi:30775
fluoroacetic acid
Cymonic acid
Fluoroacetic acid
Gifblaar poison
HFA
Monofluoressigsaure
UN 2642
acide-monofluoracetique
monofluoroacetic acid
chebi:14273
chebi:24063
chebi:24065
chebi:5114
keggC:M_C06108
seedM:M_cpd03644
secondary/obsolete/fantasy identifier