Feedback

genistein

PropertiesImageOccurences in reactions
MNX_IDMNXM1476Image of MNXM1476
#reac
in my sandbox 0
in MNXref (generic)19
in models (compartimentalized) 0
formulaC15H9O5
charge-1
mass269.22896
referencechebi:74224
InChIKeyTZBJGXHYKVUXJN-UHFFFAOYSA-M
InChIInChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-13-6-10(17)5-12(18)14(13)15(11)19/h1-7,16-18H/p-1
SMILESOc1ccc(cc1)-c1coc2cc([O-])cc(O)c2c1=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:74224
chebi:74224
genistein
5-hydroxy-3-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-olate
genistein(1-)
kegg.drug:D11680
keggD:D11680
Genistein (USAN)
hmdb:HMDB0003217 Genistein
4',5, 7-Trihydroxyisoflavone
4',5,7-Trihydroxy-isoflavone
4',5,7-Trihydroxyisoflavone
4,5,7-Trihydroxy iso-flavone
5,7,4'-Trihydroxyisoflavone
5,7-Dihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one
Genestein
Genistein 85% HPLC
Genisteol
Genisterin
Prunetol
Sophoricol
genistein
seed.compound:cpd03971
seedM:cpd03971
Genistein
4',5,7-trihydroxyisoflavone
5,7,4'-Trihydroxyisoflavone
5,7,4'-trihydroxyisoflavone
5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one
genistein
sabiork.compound:8731
sabiorkM:8731
kegg.compound:C06563
keggC:C06563
Genistein
5,7,4'-Trihydroxyisoflavone
lipidmaps:LMPK12050218
lipidmapsM:LMPK12050218
Genistein
Prunetol
CHEBI:28088
chebi:28088
genistein
4',5,7-trihydroxyisoflavone
5,7,4'-Trihydroxyisoflavone
5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-1-benzopyran-4-one
5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one
GENISTEIN
Genistein
Prunetol
Sophoricol
metacyc.compound:CPD-3141
metacycM:CPD-3141
genistein
4',5,7-trihydroxyisoflavone
5,7,4'-trihydroxyisoflavone
5,7-dihydroxy-3-(4-hydroxyphenyl)-4H-chromen-4-one
hmdb:HMDB03217
chebi:24204
chebi:42763
chebi:5302
keggC:M_C06563
keggD:M_D11680
seedM:M_cpd03971
secondary/obsolete/fantasy identifier