Feedback

(8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoate

Properties
MNX_IDMNXM1511
formulaC18H31O4
charge-1
mass311.43634
referencechebi:58659
Image of MNXM1511
InChIKeyRGJSGXNKRWWCOQ-QMEIEYGNSA-M
InChIInChI=1S/C18H32O4/c1-2-3-4-5-6-7-8-11-14-17(22-21)15-12-9-10-13-16-18(19)20/h6-7,11,14,17,21H,2-5,8-10,12-13,15-16H2,1H3,(H,19,20)/p-1/b7-6-,14-11-/t17-/m0/s1
SMILESCCCCC\C=C/C\C=C/[C@@H](CCCCCCC([O-])=O)OO

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd10528 8(R)-HPODE
(8R)-HPODE
(8R,9Z,12Z)-8-Hydroperoxyoctadeca-9,12-dienoate
(8R,9Z,12Z)-8-hydroperoxy-9,12-octadecadienoate
(8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoate
(9Z,12Z)-(8R)-8-Hydroperoxyoctadeca-9,12-dienoic acid
metacycM:CPD-13762 (8R)-HPODE
(8R,9Z,12Z)-8-hydroperoxy-9,12-octadecadienoate
(8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoate
lipidmaps:LMFA02000113 8R-HpODE
(9Z,12Z)-(8R)-8-Hydroperoxyoctadeca-9,12-dienoic acid
8R-hydroperoxy-9Z,12Z-octadecadienoic acid
hmdb:HMDB04706
keggC:M_C14831
seedM:M_cpd10528
secondary/obsolete/fantasy identifier
chebi:58659 (8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoate
8(R)-HPODE(1-)
chebi:34485 8(R)-HPODE
(8R)-8-hydroperoxylinoleic acid
(8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoic acid
(9Z,12Z)-(8R)-8-Hydroperoxyoctadeca-9,12-dienoic acid
keggC:C14831 8(R)-HPODE
(8R,9Z,12Z)-8-Hydroperoxyoctadeca-9,12-dienoate
(9Z,12Z)-(8R)-8-Hydroperoxyoctadeca-9,12-dienoic acid
hmdb:HMDB0004706 8(R)-Hydroperoxylinoleic acid
(8R)-8-Hydroperoxylinoleate
(8R)-8-Hydroperoxylinoleic acid
(8R,9Z,12Z)-8-Hydroperoxyoctadeca-9,12-dienoate
(8R,9Z,12Z)-8-Hydroperoxyoctadeca-9,12-dienoic acid
(8R,9Z,12Z)-8-hydroperoxyoctadeca-9,12-dienoic acid
(9Z,12Z)-(8R)-8-Hydroperoxyoctadeca-9,12-dienoate
(9Z,12Z)-(8R)-8-Hydroperoxyoctadeca-9,12-dienoic acid
(R-(Z,Z))-8-Hydroperoxy-9,12-octadecadienoate
(R-(Z,Z))-8-Hydroperoxy-9,12-octadecadienoic acid
8(R)-HPODE
8(R)-Hydroperoxylinoleate
8-Hpode
8-Hydroperoxylinoleic acid
8-hpode
8R-Hydroperoxy-9Z,12Z-octadecadienoate
8R-Hydroperoxy-9Z,12Z-octadecadienoic acid
MNXM489468is deprecated and replaced by this entry