Feedback

(R)-3-hydroxy-2-oxo-4-phosphooxybutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1514Image of MNXM1514
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 3
formulaC4H4O8P
charge-3
mass211.043521
referencechebi:58538
InChIKeyMZJFVXDTNBHTKZ-UWTATZPHSA-K
InChIInChI=1S/C4H7O8P/c5-2(3(6)4(7)8)1-12-13(9,10)11/h2,5H,1H2,(H,7,8)(H2,9,10,11)/p-3/t2-/m1/s1
SMILESO[C@H](COP([O-])([O-])=O)C(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58538
chebi:58538
(R)-3-hydroxy-2-oxo-4-phosphooxybutanoate
(3R)-3-hydroxy-2-oxo-4-(phosphonatoooxy)butanoate
(R)-3-hydroxy-2-oxo-4-(phosphonatoooxy)butanoate
metacyc.compound:3OH-4P-OH-ALPHA-KETOBUTYRATE
metacycM:3OH-4P-OH-ALPHA-KETOBUTYRATE
(3R)-3-hydroxy-2-oxo-4 phosphooxybutanoate
2-oxo-3-hydroxy-4-phosphobutanoate
3-hydroxy-4-phospho-hydroxy-alpha-ketobutyrate
CHEBI:27951
chebi:27951
(R)-3-hydroxy-2-oxo-4-phosphonooxybutanoic acid
(3R)-3-Hydroxy-2-oxo-4-phosphonooxybutanoate
(3R)-3-hydroxy-2-oxo-4-(phosphonooxy)butanoic acid
2-Oxo-3-hydroxy-4-phosphobutanoate
alpha-Keto-3-hydroxy-4-phosphobutyrate
bigg.metabolite:ohpb
biggM:ohpb
2-Oxo-3-hydroxy-4-phosphobutanoate
kegg.compound:C06054
keggC:C06054
2-Oxo-3-hydroxy-4-phosphobutanoate
(3R)-3-Hydroxy-2-oxo-4-phosphonooxybutanoate
(3R)-3-Hydroxy-2-oxo-4-phosphooxybutanoate
alpha-Keto-3-hydroxy-4-phosphobutyrate
seed.compound:cpd03606
seedM:cpd03606
2-Oxo-3-hydroxy-4-phosphobutanoate
(3R)-3-Hydroxy-2-oxo-4-phosphonooxybutanoate
(3R)-3-hydroxy-2-oxo-4 phosphonooxybutanoate
(3R)-3-hydroxy-2-oxo-4 phosphooxybutanoate
2-oxo-3-hydroxy-4-phosphobutanoate
3-hydroxy-4-phospho-hydroxy-alpha-ketobutyrate
alpha-Keto-3-hydroxy-4-phosphobutyrate
ohpb
hmdb:HMDB0006801 2-Oxo-3-hydroxy-4-phosphobutanoic acid
(3R)-3-Hydroxy-2-oxo-4-phosphonooxybutanoate
(3R)-3-Hydroxy-2-oxo-4-phosphonooxybutanoic acid
(3R)-3-hydroxy-2-oxo-4-(phosphonooxy)butanoic acid
2-oxo-3-Hydroxy-4-phosphobutanoate
a-keto-3-Hydroxy-4-phosphobutyrate
a-keto-3-Hydroxy-4-phosphobutyric acid
alpha-keto-3-Hydroxy-4-phosphobutyrate
alpha-keto-3-Hydroxy-4-phosphobutyric acid
alpha-keto-3-hydroxy-4-phosphobutyrate
alpha-keto-3-hydroxy-4-phosphobutyric acid
hmdb:HMDB06801
chebi:1240
chebi:19731
biggM:M_ohpb
keggC:M_C06054
seedM:M_cpd03606
secondary/obsolete/fantasy identifier