Feedback

(2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM1522Image of MNXM1522
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 0
formulaC7H5O8
charge-3
mass217.1098
referencechebi:142706
InChIKeyRQMCNDRMPZBEOD-ZETCQYMHSA-K
InChIInChI=1S/C7H8O8/c8-3(5(11)12)1-7(15,6(13)14)2-4(9)10/h15H,1-2H2,(H,9,10)(H,11,12)(H,13,14)/p-3/t7-/m0/s1
SMILESO[C@](CC([O-])=O)(CC(=O)C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:142706
chebi:142706
(2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
CHEBI:142757
chebi:142757
(2S)-2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid
(4S)-4-carboxy-4-hydroxy-2-oxoadipic acid
(4S)-4-hydroxy-4-carboxymethyl-2-oxoglutaric acid
CHEBI:58075
chebi:58075
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
metacyc.compound:4-OH-4-ACETYL-2-OXOGLUTARATE
metacycM:4-OH-4-ACETYL-2-OXOGLUTARATE
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
4-carboxy-4-hydroxy-2-ketoadipate
4-carboxy-4-hydroxy-2-oxoadipate
4-hydroxy-4-carboxymethyl-2-oxoglutarate
4-oxalocitramalate
gamma-oxalocitramalate
lipidmaps:LMFA01050481
lipidmapsM:LMFA01050481
2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid
2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid
CHEBI:17250
chebi:17250
2-hydroxy-4-oxobutane-1,2,4-tricarboxylic acid
4-carboxy-4-hydroxy-2-oxoadipic acid
4-hydroxy-4-carboxymethyl-2-oxoglutaric acid
seed.compound:cpd02544
seedM:cpd02544
4-Carboxy-4-hydroxy-2-oxoadipate
2-Hydroxy-4-oxobutane-1,2,4-tricarboxylate
2-hydroxy-4-oxobutane-1,2,4-tricarboxylate
4-Hydroxy-4-carboxymethyl-2-oxoglutarate
4-carboxy-4-hydroxy-2-ketoadipate
4-carboxy-4-hydroxy-2-oxoadipate
4-hydroxy-4-carboxymethyl-2-oxoglutarate
4-oxalocitramalate
gamma-oxalocitramalate
sabiork.compound:7090
sabiorkM:7090
kegg.compound:C04115
keggC:C04115
4-Carboxy-4-hydroxy-2-oxoadipate
2-Hydroxy-4-oxobutane-1,2,4-tricarboxylate
4-Hydroxy-4-carboxymethyl-2-oxoglutarate
chebi:1128
chebi:11585
chebi:1797
chebi:19611
chebi:20327
chebi:28186
keggC:M_C04115
seedM:M_cpd02544
secondary/obsolete/fantasy identifier