Feedback

3-(4-hydroxyphenyl)pyruvate

PropertiesImageOccurences in reactions
MNX_IDMNXM153Image of MNXM153
#reac
in my sandbox 0
in MNXref (generic)49
in models (compartimentalized) 34
formulaC9H7O4
charge-1
mass179.03498
referencechebi:36242
InChIKeyKKADPXVIOXHVKN-UHFFFAOYSA-M
InChIInChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13)/p-1
SMILESO=C([O-])C(=O)Cc1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:36242
chebi:36242
3-(4-hydroxyphenyl)pyruvate
3-(4-Hydroxyphenyl)pyruvate
3-(4-hydroxyphenyl)-2-oxopropanoate
3-(p-hydroxyphenyl)pyruvate
4-Hydroxyphenylpyruvate
HPP
p-hydroxyphenylpyruvate
bigg.metabolite:34hpp
biggM:34hpp
3-(4-Hydroxyphenyl)pyruvate
sabiork.compound:5423
sabiorkM:5423
kegg.compound:C01179
keggC:C01179
3-(4-Hydroxyphenyl)pyruvate
4-Hydroxyphenylpyruvate
p-Hydroxyphenylpyruvic acid
metacyc.compound:P-HYDROXY-PHENYLPYRUVATE
metacycM:P-HYDROXY-PHENYLPYRUVATE
3-(4-hydroxyphenyl)pyruvate
4-hydroxyphenylpyruvate
hydroxyphenylpyruvate
p-hydroxyphenylpyruvate
p-hydroxyphenylpyruvic acid
envipath:...db7737caa79b
envipathM:...db7737caa79b
4-Hydroxyphenylpyruvate
hmdb:HMDB0000707 4-Hydroxyphenylpyruvic acid
(p-Hydroxyphenyl)-pyruvate
(p-Hydroxyphenyl)-pyruvic acid
(p-Hydroxyphenyl)pyruvate
(p-Hydroxyphenyl)pyruvic acid
3-(4-HYDROXY-phenyl)pyruvIC ACID
3-(4-HYDROXY-phenyl)pyruvate
3-(4-Hydroxyphenyl)-2-oxo-propanoate
3-(4-Hydroxyphenyl)-2-oxo-propanoic acid
3-(4-Hydroxyphenyl)-2-oxopropionate
3-(4-Hydroxyphenyl)-2-oxopropionic acid
3-(4-Hydroxyphenyl)pyruvate
3-(4-Hydroxyphenyl)pyruvic acid
3-(4-hydroxyphenyl)-2-oxopropanoic acid
3-(p-Hydroxyphenyl)-2-oxopropanoate
3-(p-Hydroxyphenyl)-2-oxopropanoic acid
3-(p-Hydroxyphenyl)-2-oxopropionate
3-(p-Hydroxyphenyl)-2-oxopropionic acid
3-(p-Hydroxyphenyl)pyruvate
3-(p-Hydroxyphenyl)pyruvic acid
4-Hydroxy a-oxobenzenepropanoate
4-Hydroxy a-oxobenzenepropanoic acid
4-Hydroxy alpha-oxobenzenepropanoate
4-Hydroxy alpha-oxobenzenepropanoic acid
4-Hydroxy-a-oxobenzenepropanoate
4-Hydroxy-a-oxobenzenepropanoic acid
4-Hydroxy-alpha-oxobenzenepropanoate
4-Hydroxy-alpha-oxobenzenepropanoic acid
4-Hydroxyphenylpyruvate
4-Hydroxyphenylpyruvic acid, ion
4-Hydroxyphenylpyruvic acid, sodium salt
4-hydroxyphenylpyruvic acid
4HPPA
HPPA
Hydroxyphenylpyruvate
Hydroxyphenylpyruvic acid
Para-hydroxyphenylpyruvic acid
Testacid
p-Hydroxyphenylpyruvate
p-Hydroxyphenylpyruvic
p-Hydroxyphenylpyruvic acid
reactome:R-ALL-31365
reactomeM:R-ALL-31365
CHEBI:15999
chebi:15999
4-hydroxyphenylpyruvic acid
(4-hydroxyphenyl)pyruvic acid
(p-hydroxyphenyl)pyruvic acid
3-(4-HYDROXY-PHENYL)PYRUVIC ACID
3-(4-hydroxyphenyl)-2-oxopropanoic acid
3-(4-hydroxyphenyl)pyruvic acid
3-(p-hydroxyphenyl)-2-oxopropanoic acid
4-hydroxy alpha-oxobenzenepropanoic acid
p-Hydroxyphenylpyruvic acid
seed.compound:cpd00868
seedM:cpd00868
p-hydroxyphenylpyruvate
3-(4-Hydroxyphenyl)pyruvate
3-(4-hydroxyphenyl)pyruvate
3--4-Hydroxyphenylpyruvate
34hpp
4-Hydroxyphenylpyruvate
4-hydroxyphenylpyruvate
hydroxyphenylpyruvate
p-Hydroxyphenylpyruvic acid
p-hydroxyphenylpyruvic acid
hmdb:HMDB00707
chebi:11725
chebi:11727
chebi:12016
chebi:1431
chebi:20425
chebi:20426
chebi:42422
chebi:594665
biggM:M_34hpp
keggC:M_C01179
seedM:M_cpd00868
secondary/obsolete/fantasy identifier