Feedback

3-hydroxy-2-methylpyridine-5-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM1533Image of MNXM1533
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC7H6NO3
charge-1
mass152.12748
referencechebi:57528
InChIKeyNYEFWJFPBFRRKU-UHFFFAOYSA-M
InChIInChI=1S/C7H7NO3/c1-4-6(9)2-5(3-8-4)7(10)11/h2-3,9H,1H3,(H,10,11)/p-1
SMILESCc1ncc(cc1O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57528
chebi:57528
3-hydroxy-2-methylpyridine-5-carboxylate
5-hydroxy-6-methylnicotinate
5-hydroxy-6-methylpyridine-3-carboxylate
sabiork.compound:5489
sabiorkM:5489
envipath:...c43c9534da50
envipathM:...c43c9534da50
kegg.compound:C01270
keggC:C01270
3-Hydroxy-2-methylpyridine-5-carboxylate
seed.compound:cpd00933
seedM:cpd00933
3-Hydroxy-2-methylpyridine-5-carboxylate
3-hydroxy-2-methylpyridine-5-carboxylate
5-hydroxy-6-methylpyridine-3-carboxylate
metacyc.compound:CPD-1071
metacycM:CPD-1071
3-hydroxy-2-methylpyridine-5-carboxylate
5-hydroxy-6-methylpyridine-3-carboxylate
CHEBI:15821
chebi:15821
5-hydroxy-6-methylpyridine-3-carboxylic acid
3-Hydroxy-2-methylpyridine-5-carboxylate
5-hydroxy-6-methylnicotinic acid
chebi:11804
chebi:11808
chebi:1519
chebi:20038
keggC:M_C01270
seedM:M_cpd00933
secondary/obsolete/fantasy identifier