Feedback

 

acetoacetate

Image of MNXM154
Properties
MNX_IDMNXM154
formulaC4H5O3
charge-1
mass101.0812
referencechebi:13705
InChIKeyWDJHALXBUFZDSR-UHFFFAOYSA-M
InChIInChI=1S/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7)/p-1
SMILESCC(=O)CC([O-])=O

This chemical compound does not exist in my selection



Occurrences of acetoacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:131367 3-hydroxy-3-butenoic acid
3-hydroxybut-3-enoic acid
YMXHTKKMLXGXDC-UHFFFAOYSA-N
chebi:13705 3-oxobutanoate
Acetoacetate
Acetoacetate ion(1-)
Butanoic acid, 3-oxo-, ion(1-)
WDJHALXBUFZDSR-UHFFFAOYSA-M
acetoacetate
chebi:15344
chebi:22172
chebi:2391
chebi:40507
3-Ketobutyric acid
3-Oxobutanoic acid
3-Oxobutyric acid
3-ketobutanoic acid
3-oxobutanoic acid
Acetoacetic acid
WDJHALXBUFZDSR-UHFFFAOYSA-N
acetoacetic acid
beta-Ketobutyric acid
chebi:38871 3-hydroxybut-2-enoic acid
NVPCGXUWUBHZBD-UHFFFAOYSA-N
bigg:acac
envipath:...5be3d9719096
Acetoacetate
envipath:...f1b459bc5a3f compound 603
envipath:...af5789c697c6 Acetoacetic acid
envipath:...249ace0b14b6 compound 37934
envipath:...6750e564b19d compound 40240
envipath:...c9e1f3655a36 compound 37942
hmdb:HMDB00060 3-oxobutanoic acid
Acetoacetic acid
acetoacetic acid
kegg:C00164 3-Oxobutanoic acid
Acetoacetate
Acetoacetic acid
beta-Ketobutyric acid
lipidmaps:LMFA01030978 3-hydroxybut-2-enoic acid
lipidmaps:LMFA01030978
lipidmaps:LMFA01060003 3-oxo-butanoic acid
Acetoacetic acid
beta-ketobutyric acid
lipidmaps:LMFA01060003
metacyc:3-KETOBUTYRATE 3-KETOBUTYRATE
3-ketobutyrate
3-oxobutanate
3-oxobutanoic acid
3-oxobutyric acid
acetoacetate
acetoacetic acid
beta-ketobutyric acid
diacetic acid
oxobutyrate
reactome:29666 3-Oxobutanoate
ACA
acetoacetate
reactome:73909 ACA
acetoacetate
acetoacetic acid
sabiork:1956 3-Oxobutanoate
3-Oxobutanoic acid
3-Oxobutyrate
Acetoacetate
Acetoacetic acid
beta-Ketobutyric acid
seed:cpd00142 3-Oxobutanoic acid
Acetoacetate
Acetoacetic acid
acac
beta-Ketobutyric acid
deprecated:MNXM89744
deprecated:MNXM90257