Feedback

D-arginine

Properties
MNX_IDMNXM1552
formulaC6H15N4O2
charge1
mass175.20906
referencechebi:32689
Image of MNXM1552
InChIKeyODKSFYDXXFIFQN-SCSAIBSYSA-O
InChIInChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/p+1/t4-/m1/s1
SMILESNC(=[NH2+])NCCC[C@@H]([NH3+])C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref18
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00586 D-Arginine
D-2-Amino-5-guanidinovaleric acid
D-arginine
chebi:32690 D-argininium(2+)
D-arginine dication
D-argininediium
[(1R)-1-carboxy-4-guanidiniobutyl]ammonium
hmdb:HMDB0003416 D-Arginine
(2R)-2-amino-5-(carbamimidamido)Pentanoate
(2R)-2-amino-5-(carbamimidamido)Pentanoic acid
(2R)-2-amino-5-Guanidinopentanoate
(2R)-2-amino-5-Guanidinopentanoic acid
(2R)-2-amino-5-carbamimidamidopentanoic acid
(R)-2-amino-5-Guanidinopentanoate
(R)-2-amino-5-Guanidinopentanoic acid
D-2-amino-5-Guanidinovalerate
D-2-amino-5-Guanidinovaleric acid
D-Arginin
D-arginine
DAR
chebi:32688 D-argininate
(2R)-2-amino-5-(carbamimidamido)pentanoate
(2R)-2-amino-5-guanidinopentanoate
D-arginine anion
keggC:C00792
sabiorkM:2154
D-Arginine
D-2-Amino-5-guanidinovaleric acid
chebi:15816 D-arginine
(2R)-2-amino-5-(carbamimidamido)pentanoic acid
(2R)-2-amino-5-guanidinopentanoic acid
(R)-2-amino-5-guanidinopentanoic acid
D-2-Amino-5-guanidinovaleric acid
D-Arginin
D-Arginine
DAR
metacycM:CPD-220 D-arginine
D-2-Amino-5-guanidinovaleric acid
biggM:arg__D D-Arginine
chebi:32689 D-arginine
(2R)-2-ammonio-5-guanidiniopentanoate
D-arginine monocation
D-argininium
D-argininium(1+)
biggM:M_arg__D
chebi:12917
chebi:20917
chebi:4106
chebi:41855
hmdb:HMDB03416
keggC:M_C00792
seedM:M_cpd00586
secondary/obsolete/fantasy identifier