Feedback

D-arginine

PropertiesImageOccurences in reactions
MNX_IDMNXM1552Image of MNXM1552
#reac
in my sandbox 0
in MNXref (generic)18
in models (compartimentalized) 8
formulaC6H15N4O2
charge1
mass175.20906
referencechebi:32689
InChIKeyODKSFYDXXFIFQN-SCSAIBSYSA-O
InChIInChI=1S/C6H14N4O2/c7-4(5(11)12)2-1-3-10-6(8)9/h4H,1-3,7H2,(H,11,12)(H4,8,9,10)/p+1/t4-/m1/s1
SMILESNC(=[NH2+])NCCC[C@@H]([NH3+])C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:32689
chebi:32689
D-arginine
(2R)-2-ammonio-5-guanidiniopentanoate
D-arginine monocation
D-argininium
D-argininium(1+)
bigg.metabolite:arg__D
biggM:arg__D
D-Arginine
hmdb:HMDB0003416 D-Arginine
(2R)-2-amino-5-(carbamimidamido)Pentanoate
(2R)-2-amino-5-(carbamimidamido)Pentanoic acid
(2R)-2-amino-5-Guanidinopentanoate
(2R)-2-amino-5-Guanidinopentanoic acid
(2R)-2-amino-5-carbamimidamidopentanoic acid
(R)-2-amino-5-Guanidinopentanoate
(R)-2-amino-5-Guanidinopentanoic acid
D-2-amino-5-Guanidinovalerate
D-2-amino-5-Guanidinovaleric acid
D-Arginin
D-arginine
DAR
sabiork.compound:2154
sabiorkM:2154
kegg.compound:C00792
keggC:C00792
D-Arginine
D-2-Amino-5-guanidinovaleric acid
seed.compound:cpd00586
seedM:cpd00586
D-Arginine
D-2-Amino-5-guanidinovaleric acid
D-arginine
CHEBI:32688
chebi:32688
D-argininate
(2R)-2-amino-5-(carbamimidamido)pentanoate
(2R)-2-amino-5-guanidinopentanoate
D-arginine anion
CHEBI:15816
chebi:15816
D-arginine
(2R)-2-amino-5-(carbamimidamido)pentanoic acid
(2R)-2-amino-5-guanidinopentanoic acid
(R)-2-amino-5-guanidinopentanoic acid
D-2-Amino-5-guanidinovaleric acid
D-Arginin
D-Arginine
DAR
metacyc.compound:CPD-220
metacycM:CPD-220
D-arginine
D-2-Amino-5-guanidinovaleric acid
CHEBI:32690
chebi:32690
D-argininium(2+)
D-arginine dication
D-argininediium
[(1R)-1-carboxy-4-guanidiniobutyl]ammonium
hmdb:HMDB03416
chebi:12917
chebi:20917
chebi:4106
chebi:41855
biggM:M_arg__D
keggC:M_C00792
seedM:M_cpd00586
secondary/obsolete/fantasy identifier