|
![]() |
InChIKey | ZKLLSNQJRLJIGT-UYFOZJQFSA-N |
InChI | InChI=1S/C6H13O9P/c7-1-3(8)5(10)6(11)4(9)2-15-16(12,13)14/h3,5-8,10-11H,1-2H2,(H2,12,13,14)/t3-,5-,6-/m1/s1 |
SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)C(=O)COP(O)(O)=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 3 |
Distinct compatimentalized reactions in models | 2 |
Identifier | Description |
---|---|
metacycM:CPD-15970 seedM:cpd34822 | keto-D-fructose 1-phosphate |
sabiorkM:25599 | D-Fructose monophosphate 1-O-Phosphonato-D-fructose dianion |
hmdb:HMDB0060467 | D-fructose 1-phosphate 1-O-phosphono-D-Fructose D-Fructose 1-phosphoric acid fructose 1-phosphate {[(3S,4R,5R)-3,4,5,6-tetrahydroxy-2-oxohexyl]oxy}phosphonic acid |
chebi:18105 reactome:R-ALL-31221 | keto-D-fructose 1-phosphate 1-O-phosphono-D-fructose D-Fructose 1-phosphate D-fructose 1-(dihydrogen phosphate) |
chebi:12925 chebi:20932 chebi:4121 chebi:5173 hmdb:HMDB60467 seedM:M_cpd34822 | secondary/obsolete/fantasy identifier |
MNXM167553 | is deprecated and replaced by this entry |
MNXM507469 | is deprecated and replaced by this entry |