Feedback

(S)-2-succinylamino-6-oxoheptanedioate

Properties
MNX_IDMNXM1563
formulaC11H12NO8
charge-3
mass286.21492
referencechebi:15685
Image of MNXM1563
InChIKeySDVXSCSNVVZWDD-LURJTMIESA-K
InChIInChI=1S/C11H15NO8/c13-7(11(19)20)3-1-2-6(10(17)18)12-8(14)4-5-9(15)16/h6H,1-5H2,(H,12,14)(H,15,16)(H,17,18)(H,19,20)/p-3/t6-/m0/s1
SMILES[O-]C(=O)CCC(=O)N[C@@H](CCCC(=O)C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models5

Similar chemical compounds in external resources
IdentifierDescription
chebi:7341
keggC:C05537
seedM:cpd03288
N-Succinyl-2-amino-6-oxopimelate
chebi:15685 (S)-2-succinylamino-6-oxoheptanedioate
(2S)-2-(3-carboxylatopropanamido)-6-oxoheptanedioate
L-2-succinylamino-6-oxoheptanedioate(3-)
N-succinyl-L-2-amino-6-oxoheptanedioate
N-succinyl-L-2-amino-6-oxopimelate
metacycM:N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-succinyl-2-amino-6-ketopimelate
N-Succinyl-2-L-amino-6-oxoheptanedioate
N-succinyl-L-2-amino-6-oxoheptanedioate
succinyl-epsilon-keto-alpha-aminopimelate
biggM:sl2a6o N-Succinyl-2-L-amino-6-oxoheptanedioate
chebi:35266 L-2-succinylamino-6-oxoheptanedioic acid
(2S)-2-(3-carboxypropanamido)-6-oxoheptanedioic acid
N-Succinyl-2-amino-6-oxo-L-pimelic acid
N-Succinyl-epsilon-keto-L-aminopimelic acid
keggC:C04462 N-Succinyl-2-L-amino-6-oxoheptanedioate
(S)-2-(Succinylamino)-6-oxoheptanedioate
N-Succinyl-2-amino-6-oxo-L-pimelic acid
N-Succinyl-L-2-amino-6-oxoheptanedioate
N-Succinyl-L-2-amino-6-oxopimelate
N-Succinyl-epsilon-keto-L-aminopimelic acid
seedM:cpd02724 N-Succinyl-L-2-amino-6-oxopimelate
(S)-2-(Succinylamino)-6-oxoheptanedioate
N-Succinyl-2-L-amino-6-oxoheptanedioate
N-Succinyl-2-amino-6-oxo-L-pimelic acid
N-Succinyl-L-2-amino-6-oxoheptanedioate
N-Succinyl-epsilon-keto-L-aminopimelic acid
N-succinyl-2-amino-6-ketopimelate
N-succinyl-L-2-amino-6-oxoheptanedioate
sl2a6o
succinyl-epsilon-keto-alpha-aminopimelate
hmdb:HMDB0012266 N-Succinyl-2-amino-6-ketopimelate
(2S)-2-(3-carboxypropanamido)-6-Oxoheptanedioate
(2S)-2-(3-carboxypropanamido)-6-Oxoheptanedioic acid
(2S)-2-(3-carboxypropanamido)-6-oxoheptanedioic acid
(S)-2-(succinylamino)-6-Oxoheptanedioate
(S)-2-(succinylamino)-6-Oxoheptanedioic acid
L-2-succinylamino-6-Oxoheptanedioate
L-2-succinylamino-6-Oxoheptanedioic acid
N-Succinyl-2-L-amino-6-oxoheptanedioate
N-Succinyl-2-L-amino-6-oxoheptanedioic acid
N-Succinyl-2-amino-6-ketopimelic acid
N-Succinyl-2-amino-6-oxo-L-pimelate
N-Succinyl-2-amino-6-oxo-L-pimelic acid
N-Succinyl-L-2-amino-6-oxoheptanedioate
N-Succinyl-L-2-amino-6-oxoheptanedioic acid
N-Succinyl-L-2-amino-6-oxopimelate
N-Succinyl-epsilon-keto-L-aminopimelate
N-Succinyl-epsilon-keto-L-aminopimelic acid
Succinyl-epsilon-keto-alpha-aminopimelate
biggM:M_sl2a6o
chebi:10967
chebi:12616
chebi:21789
chebi:21790
chebi:7340
hmdb:HMDB12266
keggC:M_C04462
keggC:M_C05537
seedM:M_cpd02724
seedM:M_cpd03288
secondary/obsolete/fantasy identifier
MNXM587858is deprecated and replaced by this entry