Feedback

 

L-2-succinylamino-6-oxopimelate

Image of MNXM1563
Properties
MNX_IDMNXM1563
formulaC11H12NO8
charge-3
mass286.2165
referencechebi:15685
InChIKeySDVXSCSNVVZWDD-LURJTMIESA-K
InChIInChI=1S/C11H15NO8/c13-7(11(19)20)3-1-2-6(10(17)18)12-8(14)4-5-9(15)16/h6H,1-5H2,(H,12,14)(H,15,16)(H,17,18)(H,19,20)/p-3/t6-/m0/s1
SMILES[O-]C(=O)CCC(=O)N[C@@H](CCCC(=O)C([O-])=O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of L-2-succinylamino-6-oxopimelate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:sl2a6o N-Succinyl-2-L-amino-6-oxoheptanedioate
chebi:10967
chebi:12616
chebi:15685
chebi:21789
(2S)-2-(3-carboxylatopropanamido)-6-oxoheptanedioate
L-2-succinylamino-6-oxoheptanedioate(3-)
L-2-succinylamino-6-oxopimelate
N-succinyl-L-2-amino-6-oxoheptanedioate
N-succinyl-L-2-amino-6-oxopimelate
SDVXSCSNVVZWDD-LURJTMIESA-K
chebi:21790
chebi:35266
chebi:7340
(2S)-2-(3-carboxypropanamido)-6-oxoheptanedioic acid
L-2-succinylamino-6-oxoheptanedioic acid
N-Succinyl-2-amino-6-oxo-L-pimelic acid
N-Succinyl-epsilon-keto-L-aminopimelic acid
SDVXSCSNVVZWDD-LURJTMIESA-N
hmdb:HMDB12266 (2S)-2-(3-carboxypropanamido)-6-oxoheptanedioic acid
N-Succinyl-2-amino-6-ketopimelate
kegg:C04462 (S)-2-(Succinylamino)-6-oxoheptanedioate
N-Succinyl-2-L-amino-6-oxoheptanedioate
N-Succinyl-2-amino-6-oxo-L-pimelic acid
N-Succinyl-L-2-amino-6-oxoheptanedioate
N-Succinyl-L-2-amino-6-oxopimelate
N-Succinyl-epsilon-keto-L-aminopimelic acid
metacyc:N-SUCCINYL-2-AMINO-6-KETOPIMELATE N-SUCCINYL-2-AMINO-6-KETOPIMELATE
N-Succinyl-2-L-amino-6-oxoheptanedioate
N-succinyl-2-amino-6-ketopimelate
N-succinyl-L-2-amino-6-oxoheptanedioate
succinyl-epsilon-keto-alpha-aminopimelate
seed:cpd02724 (S)-2-(Succinylamino)-6-oxoheptanedioate
N-Succinyl-2-L-amino-6-oxoheptanedioate
N-Succinyl-2-amino-6-oxo-L-pimelic acid
N-Succinyl-L-2-amino-6-oxoheptanedioate
N-Succinyl-L-2-amino-6-oxopimelate
N-Succinyl-epsilon-keto-L-aminopimelic acid
sl2a6o