Feedback

methylmalonate

PropertiesImageOccurences in reactions
MNX_IDMNXM1572Image of MNXM1572
#reac
in my sandbox 0
in MNXref (generic)21
in models (compartimentalized) 12
formulaC4H4O4
charge-2
mass116.07216
referencechebi:17453
InChIKeyZIYVHBGGAOATLY-UHFFFAOYSA-L
InChIInChI=1S/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8)/p-2
SMILESCC(C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17453
chebi:17453
methylmalonate
methylmalonate dianion
methylmalonate(2-)
methylpropanedioate
bigg.metabolite:HC00900
biggM:HC00900
bigg.metabolite:mm
biggM:mm
bigg.metabolite:mmal
biggM:mmal
Methylmalonate
sabiork.compound:2376
sabiorkM:2376
kegg.compound:C02170
keggC:C02170
Methylmalonate
Methylmalonic acid
seed.compound:cpd01468
seedM:cpd01468
Methylmalonate
Methylmalonic acid
methylmalonate
mmal
envipath:...441f8b4d900b
envipathM:...441f8b4d900b
Methylmalonic acid
hmdb:HMDB0000202 Methylmalonic acid
1,1-Ethanedicarboxylate
1,1-Ethanedicarboxylic acid
2-Methylmalonate
2-Methylmalonic acid
2-methylpropanedioic acid
Acid, methylmalonic
Isosuccinate
Isosuccinic acid
Methyl-malonate
Methyl-malonic acid
Methyl-propanedioate
Methyl-propanedioic acid
Methylmalonate
Methylpropanedioate
Methylpropanedioic acid
a-Methylmalonate
a-Methylmalonic acid
alpha-Methylmalonate
alpha-Methylmalonic acid
alpha-methylmalonate
alpha-methylmalonic acid
methylmalonic acid
lipidmaps:LMFA01170118
lipidmapsM:LMFA01170118
Methylmalonic acid
2-methyl-propanedioic acid
CHEBI:30861
chebi:30861
methylmalonate(1-)
2-carboxypropanoate
metacyc.compound:CPD-546
metacycM:CPD-546
methylmalonate
Methylmalonic acid
CHEBI:30860
chebi:30860
methylmalonic acid
1,1-Ethanedicarboxylic acid
2-methylmalonic acid
Isosuccinic acid
METHYLMALONIC ACID
Methylmalonic acid
alpha-methylmalonic acid
methylpropanedioic acid
hmdb:HMDB00202
chebi:14603
chebi:25317
chebi:25319
chebi:42270
chebi:6881
biggM:M_HC00900
biggM:M_mm
biggM:M_mmal
keggC:M_C02170
seedM:M_cpd01468
secondary/obsolete/fantasy identifier