Feedback

methylmalonate

Properties
MNX_IDMNXM1572
formulaC4H4O4
charge-2
mass116.07216
referencechebi:17453
Image of MNXM1572
InChIKeyZIYVHBGGAOATLY-UHFFFAOYSA-L
InChIInChI=1S/C4H6O4/c1-2(3(5)6)4(7)8/h2H,1H3,(H,5,6)(H,7,8)/p-2
SMILESCC(C([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref22
Distinct compatimentalized reactions in models12

Similar chemical compounds in external resources
IdentifierDescription
keggC:C02170
sabiorkM:2376
Methylmalonate
Methylmalonic acid
chebi:30860 methylmalonic acid
1,1-Ethanedicarboxylic acid
2-methylmalonic acid
Isosuccinic acid
METHYLMALONIC ACID
Methylmalonic acid
alpha-methylmalonic acid
methylpropanedioic acid
chebi:30861 methylmalonate(1-)
2-carboxypropanoate
chebi:17453 methylmalonate
methylmalonate dianion
methylmalonate(2-)
methylpropanedioate
metacycM:CPD-546 methylmalonate
Methylmalonic acid
biggM:M_HC00900
biggM:M_mm
biggM:M_mmal
chebi:14603
chebi:25317
chebi:25319
chebi:42270
chebi:6881
hmdb:HMDB00202
keggC:M_C02170
seedM:M_cpd01468
secondary/obsolete/fantasy identifier
envipath:...441f8b4d900b Methylmalonic acid
lipidmaps:LMFA01170118 Methylmalonic acid
2-methyl-propanedioic acid
seedM:cpd01468 Methylmalonate
Methylmalonic acid
methylmalonate
mmal
biggM:HC00900
biggM:mm
biggM:mmal
Methylmalonate
hmdb:HMDB0000202 Methylmalonic acid
1,1-Ethanedicarboxylate
1,1-Ethanedicarboxylic acid
2-Methylmalonate
2-Methylmalonic acid
2-methylpropanedioic acid
Acid, methylmalonic
Isosuccinate
Isosuccinic acid
Methyl-malonate
Methyl-malonic acid
Methyl-propanedioate
Methyl-propanedioic acid
Methylmalonate
Methylpropanedioate
Methylpropanedioic acid
a-Methylmalonate
a-Methylmalonic acid
alpha-Methylmalonate
alpha-Methylmalonic acid
alpha-methylmalonate
alpha-methylmalonic acid
methylmalonic acid