Feedback

N-benzoylglycine

PropertiesImageOccurences in reactions
MNX_IDMNXM1577Image of MNXM1577
#reac
in my sandbox 0
in MNXref (generic)9
in models (compartimentalized) 11
formulaC9H8NO3
charge-1
mass178.05097
referencechebi:606565
InChIKeyQIAFMBKCNZACKA-UHFFFAOYSA-M
InChIInChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)/p-1
SMILESO=C([O-])CNC(=O)c1ccccc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:606565
chebi:606565
N-benzoylglycine
(benzoylamino)acetate
2-benzamidoacetate
N-benzoylglycinate
N-benzoylglycinate anion
N-benzoylglycinate(1-)
hippurate
sabiork.compound:5679
sabiorkM:5679
kegg.compound:C01586
keggC:C01586
Hippurate
Benzoylaminoacetic acid
Hippuric acid
N-Benzoylglycine
seed.compound:cpd01114
seedM:cpd01114
Hippurate
Benzoylaminoacetic acid
Hippuric acid
N-Benzoylglycine
N-benzoylglycine
benzoylaminoacetic acid
bgly
hippurate
hippuric acid
hmdb:HMDB0000714 Hippuric acid
(Benzoylamino)-acetate
(Benzoylamino)-acetic acid
2-(phenylformamido)acetic acid
2-Benzamidoacetate
2-Benzamidoacetic acid
Benzamidoacetate
Benzamidoacetic acid
Benzamidoessigsaeure
Benzoylaminoacetate
Benzoylaminoacetic acid
Benzoylaminoessigsaeure
Benzoylglycine
Hippate
Hippic acid
Hippurate
Hippursaeure
N-Benzoylglycinate
N-Benzoylglycine
Phenylcarbonylaminoacetate
Phenylcarbonylaminoacetic acid
hippuric acid
bigg.metabolite:bgly
biggM:bgly
N-Benzoylglycine
reactome:R-ALL-159564
reactomeM:R-ALL-159564
CHEBI:18089
chebi:18089
N-benzoylglycine
Benzamidoacetic acid
Benzamidoessigsaeure
Benzoylaminoacetic acid
Benzoylaminoessigsaeure
Hippurate
Hippuric acid
Hippursaeure
N-Benzoylglycine
Phenylcarbonylaminoacetic acid
metacyc.compound:CPD-425
metacycM:CPD-425
hippurate
N-benzoylglycine
benzoylaminoacetic acid
hippuric acid
hmdb:HMDB0062583
hmdb:HMDB00714
hmdb:HMDB62583
chebi:12492
chebi:14400
chebi:24594
chebi:24595
chebi:5725
biggM:M_bgly
keggC:M_C01586
seedM:M_cpd01114
secondary/obsolete/fantasy identifier