Feedback

N-benzoylglycine

Properties
MNX_IDMNXM1577
formulaC9H8NO3
charge-1
mass178.16476
referencechebi:606565
Image of MNXM1577
InChIKeyQIAFMBKCNZACKA-UHFFFAOYSA-M
InChIInChI=1S/C9H9NO3/c11-8(12)6-10-9(13)7-4-2-1-3-5-7/h1-5H,6H2,(H,10,13)(H,11,12)/p-1
SMILES[O-]C(=O)CNC(=O)c1ccccc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref9
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
biggM:bgly N-Benzoylglycine
seedM:cpd01114 Hippurate
Benzoylaminoacetic acid
Hippuric acid
N-Benzoylglycine
N-benzoylglycine
benzoylaminoacetic acid
bgly
hippurate
hippuric acid
chebi:606565 N-benzoylglycine
(benzoylamino)acetate
2-benzamidoacetate
N-benzoylglycinate
N-benzoylglycinate anion
N-benzoylglycinate(1-)
hippurate
keggC:C01586
sabiorkM:5679
Hippurate
Benzoylaminoacetic acid
Hippuric acid
N-Benzoylglycine
metacycM:CPD-425 hippurate
N-benzoylglycine
benzoylaminoacetic acid
hippuric acid
hmdb:HMDB0062583 N-benzoylglycinate
(benzoylamino)-Acetate
(benzoylamino)-Acetic acid
2-(phenylformamido)acetic acid
2-Benzamidoacetate
2-Benzamidoacetic acid
Benzamidoacetate
Benzamidoacetic acid
Benzamidoessigsaeure
Benzoylaminoacetate
Benzoylaminoacetic acid
Benzoylaminoessigsaeure
Benzoylglycine
Hippate
Hippic acid
Hippurate
Hippuric acid, (14)C-labeled
Hippuric acid, monoammonium salt
Hippuric acid, monopotassium salt
Hippuric acid, monosodium salt
Hippursaeure
N-Benzoylglycine
Phenylcarbonylaminoacetate
Phenylcarbonylaminoacetic acid
hippuric acid
hmdb:HMDB0000714 Hippuric acid
(benzoylamino)-Acetate
(benzoylamino)-Acetic acid
2-(phenylformamido)acetic acid
2-Benzamidoacetate
2-Benzamidoacetic acid
Benzamidoacetate
Benzamidoacetic acid
Benzamidoessigsaeure
Benzoylaminoacetate
Benzoylaminoacetic acid
Benzoylaminoessigsaeure
Benzoylglycine
Hippate
Hippic acid
Hippurate
Hippuric acid, (14)C-labeled
Hippuric acid, monoammonium salt
Hippuric acid, monopotassium salt
Hippuric acid, monosodium salt
Hippursaeure
N-Benzoylglycine
Phenylcarbonylaminoacetate
Phenylcarbonylaminoacetic acid
hippuric acid
biggM:M_bgly
chebi:12492
chebi:14400
chebi:24594
chebi:24595
chebi:5725
hmdb:HMDB00714
hmdb:HMDB62583
keggC:M_C01586
seedM:M_cpd01114
secondary/obsolete/fantasy identifier
chebi:18089
reactome:R-ALL-159564
N-benzoylglycine
Benzamidoacetic acid
Benzamidoessigsaeure
Benzoylaminoacetic acid
Benzoylaminoessigsaeure
Hippurate
Hippuric acid
Hippursaeure
N-Benzoylglycine
Phenylcarbonylaminoacetic acid
MNXM527138is deprecated and replaced by this entry
MNXM527139is deprecated and replaced by this entry
MNXM90723is deprecated and replaced by this entry