|
![]() |
InChIKey | GVVPGTZRZFNKDS-YFHOEESVSA-K |
InChI | InChI=1S/C10H20O7P2/c1-9(2)5-4-6-10(3)7-8-16-19(14,15)17-18(11,12)13/h5,7H,4,6,8H2,1-3H3,(H,14,15)(H2,11,12,13)/p-3/b10-7- |
SMILES | CC(C)=CCC\C(C)=C/COP([O-])(=O)OP([O-])([O-])=O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 16 |
Distinct compatimentalized reactions in models | 0 |
Identifier | Description |
---|---|
seedM:cpd28738 | neryl diphosphate neryl pyrophosphate |
chebi:57665 | neryl diphosphate (2Z)-3,7-dimethylocta-2,6-dien-1-yl diphosphate neryl diphosphate trianion neryl diphosphate(3-) |
chebi:14642 chebi:25504 chebi:7527 keggC:M_C02569 seedM:M_cpd01681 seedM:M_cpd12460 seedM:M_cpd28738 | secondary/obsolete/fantasy identifier |
metacycM:CPD-461 | neryl diphosphate (2Z)-neryl diphosphate NPP neryl pyrophosphate omega,Z-neryl diphosphate |
seedM:cpd01681 | Neryl diphosphate (2Z)-neryl diphosphate NPP Neryl pyrophosphate neryl diphosphate neryl pyrophosphate omega,Z-neryl diphosphate |
chebi:16172 | neryl diphosphate (2Z)-3,7-dimethylocta-2,6-dien-1-yl trihydrogen diphosphate Neryl diphosphate Neryl pyrophosphate |
keggC:C02569 lipidmaps:LMPR0102010002 sabiorkM:1721 | Neryl diphosphate Neryl pyrophosphate |
sabiorkM:1787 seedM:cpd12460 | poly-cis-Polyprenyl diphosphate |
MNXM723085 | is deprecated and replaced by this entry |
MNXM93691 | is deprecated and replaced by this entry |