Feedback

2-oxobutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM159Image of MNXM159
#reac
in my sandbox 0
in MNXref (generic)101
in models (compartimentalized) 56
formulaC4H5O3
charge-1
mass101.02442
referencechebi:16763
InChIKeyTYEYBOSBBBHJIV-UHFFFAOYSA-M
InChIInChI=1S/C4H6O3/c1-2-3(5)4(6)7/h2H2,1H3,(H,6,7)/p-1
SMILESCCC(=O)C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16763
chebi:16763
2-oxobutanoate
2-Ketobutanoate
2-Oxobutyrate
2-ketobutyrate
alpha-ketobutyrate
alpha-oxobutyrate
hmdb:HMDB0000005 2-Ketobutyric acid
2-Ketobutanoate
2-Ketobutanoic acid
2-Ketobutyrate
2-Oxobutanoate
2-Oxobutanoic acid
2-Oxobutyrate
2-Oxobutyric acid
2-oxo-Butanoate
2-oxo-Butanoic acid
2-oxo-Butyrate
2-oxo-Butyric acid
2-oxo-N-Butyrate
2-oxo-N-Butyric acid
2-oxobutanoic acid
3-Methyl pyruvate
3-Methyl pyruvic acid
3-Methylpyruvate
3-Methylpyruvic acid
Methyl-pyruvate
Methyl-pyruvic acid
Propionyl-formate
Propionyl-formic acid
a-Keto-N-butyrate
a-Keto-N-butyric acid
a-Ketobutyrate
a-Ketobutyric acid
a-Oxobutyrate
a-Oxobutyric acid
a-oxo-N-Butyrate
a-oxo-N-Butyric acid
alpha-Keto-N-butyrate
alpha-Keto-N-butyric acid
alpha-Ketobutric acid
alpha-Ketobutyrate
alpha-Ketobutyric acid
alpha-Ketobutyric acid, sodium salt
alpha-Oxobutyrate
alpha-Oxobutyric acid
alpha-ketobutyrate
alpha-ketobutyric acid
alpha-oxo-N-Butyrate
alpha-oxo-N-Butyric acid
alpha-oxo-N-butyrate
alpha-oxo-N-butyric acid
bigg.metabolite:2obut
biggM:2obut
envipath:...3b00be5e4e8b
envipathM:...3b00be5e4e8b
2-Oxobutanoate
kegg.compound:C00109
keggC:C00109
2-Oxobutanoate
2-Ketobutyric acid
2-Oxobutanoic acid
2-Oxobutyrate
2-Oxobutyric acid
alpha-Ketobutyrate
alpha-Ketobutyric acid
sabiork.compound:1934
sabiorkM:1934
2-Oxobutyrate
2-Ketobutyrate
2-Ketobutyric acid
2-Oxobutanoate
2-Oxobutanoic acid
2-Oxobutyric acid
alpha-Ketobutyrate
alpha-Oxobutyrate
seed.compound:cpd00094
seedM:cpd00094
2-Oxobutyrate
2-Ketobutyric acid
2-Oxobutanoate
2-Oxobutanoic acid
2-Oxobutyric acid
2-keto-butyrate
2-ketobutyrate
2-ketobutyric acid
2-oxo-butyrate
2-oxobutanoate
2-oxobutanoic acid
2-oxobutyrate
2-oxobutyric acid
2obut
a-ketobutyric acid
alpha-Ketobutyrate
alpha-Ketobutyric acid
alpha-ketobutyrate
alpha-ketobutyric acid
alpha-oxobutyric acid
metacyc.compound:2-OXOBUTANOATE
metacycM:2-OXOBUTANOATE
2-oxobutanoate
2-keto-butyrate
2-ketobutyrate
2-ketobutyric acid
2-oxo-butyrate
2-oxobutanoic acid
2-oxobutyrate
2-oxobutyric acid
a-ketobutyric acid
alpha-ketobutyrate
alpha-ketobutyric acid
alpha-oxobutyric acid
reactome:R-ALL-936714
reactomeM:R-ALL-936714
CHEBI:30831
chebi:30831
2-oxobutanoic acid
2-KETOBUTYRIC ACID
2-Ketobutanoic acid
2-Ketobutyric acid
2-Oxobutanoic acid
2-Oxobutyric acid
3-methyl pyruvic acid
alpha-Ketobutyrate
alpha-Ketobutyric acid
alpha-ketobutyric acid
alpha-oxo-n-butyric acid
CHEBI:144836
chebi:144836
2-oxobutyric acid-(13)C4,3,3-d2
2-ketobutyric acid-(13)C4,3,3-d2
2-oxo((13)C4,3,3-(2)H2)butanoic acid
lipidmaps:LMFA01060002
lipidmapsM:LMFA01060002
3-methyl pyruvic acid
2-oxo-butanoic acid
FA 4:1
O
envipath:...253fcbde268f
envipathM:...253fcbde268f
compound 38030
hmdb:HMDB00005
hmdb:HMDB0006544
hmdb:HMDB06544
chebi:11636
chebi:1250
chebi:19741
chebi:19743
chebi:39748
biggM:M_2obut
keggC:M_C00109
seedM:M_cpd00094
secondary/obsolete/fantasy identifier