Feedback

pyrrole-2-carboxylate

Properties
MNX_IDMNXM1590
formulaC5H4NO2
charge-1
mass110.0908
referencechebi:27660
Image of MNXM1590
InChIKeyWRHZVMBBRYBTKZ-UHFFFAOYSA-M
InChIInChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8)/p-1
SMILES[O-]C(=O)c1ccc[nH]1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref5
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
sabiorkM:8286 Pyrrole-2-carboxylate
PAC
hmdb:HMDB0004230 Pyrrole-2-carboxylic acid
1H-Pyrrole-2-carboxylic acid
1H-Pyrrole-2-carboxylic acid (9ci)
1H-pyrrole-2-carboxylic acid
2-Minaline
2-Pyrrolecarboxylate
2-Pyrrolecarboxylic acid
2-Pyrrolecarboxylic acid, monosodium salt
Minalin
Minaline
PCA
PYC
Pyrrole-2-carboxylate
minalin
chebi:26451
chebi:26453
chebi:45388
chebi:8684
hmdb:HMDB0003094
hmdb:HMDB03094
hmdb:HMDB04230
keggC:M_C05942
seedM:M_cpd03533
secondary/obsolete/fantasy identifier
chebi:27660 pyrrole-2-carboxylate
1H-pyrrole-2-carboxylate
chebi:36751 pyrrole-2-carboxylic acid
1H-pyrrole-2-carboxylic acid
2-pyrrolecarboxylic acid
Minaline
PCA
Pyrrole-2-carboxylate
metacycM:PYRROLE-2-CARBOXYLATE pyrrole-2-carboxylate
1H-pyrrole-2-carboxylic acid
2-pyrrolecarboxylic acid
PCA
minalin
pyrrole-2-carboxylic acid
envipath:...858d3baeafa5
keggC:C05942
Pyrrole-2-carboxylate
seedM:cpd03533 Pyrrole-2-carboxylate
1H-pyrrole-2-carboxylic acid
2-pyrrolecarboxylic acid
PCA
minalin
pyrrole-2-carboxylate
pyrrole-2-carboxylic acid