Feedback

pyrrole-2-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM1590Image of MNXM1590
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC5H4NO2
charge-1
mass110.0908
referencechebi:27660
InChIKeyWRHZVMBBRYBTKZ-UHFFFAOYSA-M
InChIInChI=1S/C5H5NO2/c7-5(8)4-2-1-3-6-4/h1-3,6H,(H,7,8)/p-1
SMILES[O-]C(=O)c1ccc[nH]1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:27660
chebi:27660
pyrrole-2-carboxylate
1H-pyrrole-2-carboxylate
envipath:...858d3baeafa5
envipathM:...858d3baeafa5
kegg.compound:C05942
keggC:C05942
Pyrrole-2-carboxylate
seed.compound:cpd03533
seedM:cpd03533
Pyrrole-2-carboxylate
1H-pyrrole-2-carboxylic acid
2-pyrrolecarboxylic acid
PCA
minalin
pyrrole-2-carboxylate
pyrrole-2-carboxylic acid
sabiork.compound:8286
sabiorkM:8286
Pyrrole-2-carboxylate
PAC
hmdb:HMDB0004230 Pyrrole-2-carboxylic acid
1H-Pyrrole-2-carboxylic acid
1H-Pyrrole-2-carboxylic acid (9ci)
1H-pyrrole-2-carboxylic acid
2-Minaline
2-Pyrrolecarboxylate
2-Pyrrolecarboxylic acid
2-Pyrrolecarboxylic acid, monosodium salt
Minalin
Minaline
PCA
PYC
Pyrrole-2-carboxylate
minalin
metacyc.compound:PYRROLE-2-CARBOXYLATE
metacycM:PYRROLE-2-CARBOXYLATE
pyrrole-2-carboxylate
1H-pyrrole-2-carboxylic acid
2-pyrrolecarboxylic acid
PCA
minalin
pyrrole-2-carboxylic acid
CHEBI:36751
chebi:36751
pyrrole-2-carboxylic acid
1H-pyrrole-2-carboxylic acid
2-pyrrolecarboxylic acid
Minaline
PCA
Pyrrole-2-carboxylate
hmdb:HMDB0003094
hmdb:HMDB03094
hmdb:HMDB04230
chebi:26451
chebi:26453
chebi:45388
chebi:8684
keggC:M_C05942
seedM:M_cpd03533
secondary/obsolete/fantasy identifier