|
![]() |
InChIKey | KTVPXOYAKDPRHY-AIHAYLRMSA-N |
InChI | InChI=1S/C5H11O8P/c6-3-2(1-12-14(9,10)11)13-5(8)4(3)7/h2-8H,1H2,(H2,9,10,11)/t2-,3-,4-,5+/m1/s1 |
SMILES | O[C@H]1O[C@H](COP(O)(O)=O)[C@@H](O)[C@H]1O |
#reac | |
---|---|
Distinct reactions in my sandbox | 0 |
Distinct generic reactions in MNXref | 78 |
Distinct compatimentalized reactions in models | 41 |
Identifier | Description |
---|---|
chebi:140679 | alpha-D-Ribose 5-phosphate(2-) |
chebi:52742 | D-ribofuranose 5-phosphate D-Ribose 5-phosphate D-ribofuranose 5-(dihydrogen phosphate) D-ribose 5'-phosphate D-ribose-5-P Ribose 5-phosphate |
seedM:cpd00101 | ribose-5-phosphate CPD-15317 D-Ribose 5-phosphate D-ribose 5'-phosphate D-ribose 5-phosphate D-ribose-5-P D-ribose-5-phosphate D-ribose-5-phosphoric acid RIBOSE-5P Ribose 5-phosphate aldehydo-D-ribose 5-phosphate alpha-D-Ribose5-phosphate alpha-D-ribose-5-phosphate keto-D-ribose 5-phosphate r5p ribose-5-P ribose-5-phosphoric acid ribose-5P |
hmdb:HMDB0001548 | D-Ribose 5-phosphate D-Ribose 5'-phosphate D-Ribose 5'-phosphoric acid D-Ribose 5-phosphoric acid D-Ribose-5-P D-Ribose-5-phosphate D-Ribose-5-phosphorate D-Ribose-5-phosphoric acid D-ribofuranose 5-phosphate Ribose 5-phosphate Ribose 5-phosphoric acid Ribose-5-P Ribose-5-phosphate Ribose-5-phosphorate Ribose-5-phosphoric acid Ribose-5P {[(2R,3S,4R)-3,4,5-trihydroxyoxolan-2-yl]methoxy}phosphonic acid |
metacycM:CPD-15317 | D-ribofuranose 5-phosphate |
biggM:r5p | Alpha-D-Ribose 5-phosphate |
seedM:cpd19028 | alpha-D-Ribose 5-phosphate alpha-D-ribofuranose 5-phosphate alpha-D-ribose 5-phosphate |
chebi:78346 | D-ribose 5-phosphate 5-O-phosphonato-D-ribofuranose D-ribofuranose 5-phosphate(2-) |
keggC:C03736 sabiorkM:1473 | alpha-D-Ribose 5-phosphate |
metacycM:CPD-15318 | alpha-D-ribose 5-phosphate alpha-D-ribofuranose 5-phosphate |
keggC:C00117 | D-Ribose 5-phosphate Ribose 5-phosphate |
biggM:M_r5p chebi:10270 chebi:12331 chebi:22413 hmdb:HMDB01548 keggC:M_C00117 keggC:M_C03736 seedM:M_cpd00101 seedM:M_cpd19028 | secondary/obsolete/fantasy identifier |
chebi:18189 | alpha-D-ribose 5-phosphate 5-O-phosphono-alpha-D-ribofuranose alpha-D-Ribose 5-phosphate alpha-D-ribofuranose 5-(dihydrogen phosphate) alpha-D-ribofuranose 5-phosphate |
MNXM116 | is deprecated and replaced by MNXM722712 |
MNXM155062 | is deprecated and replaced by MNXM722712 |
MNXM15900 | is deprecated and replaced by this entry |
MNXM15900 | is deprecated and replaced by MNXM729957 (aldehydo-D-ribose 5-phosphate) |
MNXM15900 | is deprecated and replaced by MNXM729958 (D-ribose 5-phosphate) |
MNXM722712 | is deprecated and replaced by this entry |
MNXM722712 | is deprecated and replaced by MNXM729957 (aldehydo-D-ribose 5-phosphate) |
MNXM722712 | is deprecated and replaced by MNXM729958 (D-ribose 5-phosphate) |
MNXM89643 | is deprecated and replaced by MNXM722712 |
MNXM89650 | is deprecated and replaced by MNXM722712 |
MNXM89959 | is deprecated and replaced by MNXM722712 |