Feedback

(2S)-2-isopropyl-3-oxosuccinate

PropertiesImageOccurences in reactions
MNX_IDMNXM1602Image of MNXM1602
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 5
formulaC7H8O5
charge-2
mass172.13542
referencechebi:17214
InChIKeyHIIZAGQWABAMRR-BYPYZUCNSA-L
InChIInChI=1S/C7H10O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-4H,1-2H3,(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILESCC(C)[C@H](C([O-])=O)C(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17214
chebi:17214
(2S)-2-isopropyl-3-oxosuccinate
(2S)-2-isopropyl-3-oxosuccinate(2-)
(2S)-3-oxo-2-(propan-2-yl)butanedioate
kegg.compound:C04236
keggC:C04236
(2S)-2-Isopropyl-3-oxosuccinate
2-Oxo-4-methyl-3-carboxypentanoate
3-Carboxy-4-methyl-2-oxopentanoate
metacyc.compound:CPD-7100
metacycM:CPD-7100
(2S)-2-isopropyl-3-oxosuccinate
2-isopropyl-3-oxosuccinate
CHEBI:1467
chebi:1467
(2S)-2-isopropyl-3-oxosuccinic acid
(2S)-2-(1-methylethyl)-3-oxobutanedioic acid
(2S)-2-Isopropyl-3-oxosuccinate
(2S)-3-oxo-2-(propan-2-yl)butanedioic acid
3-Carboxy-4-methyl-2-oxopentanoate
hmdb:HMDB0012149 2-Isopropyl-3-oxosuccinate
(2S)-2-(1-Methylethyl)-3-oxobutanedioate
(2S)-2-(1-Methylethyl)-3-oxobutanedioic acid
(2S)-2-Isopropyl-3-oxosuccinate
(2S)-2-Isopropyl-3-oxosuccinic acid
(2S)-2-isopropyl-3-oxobutanedioic acid
(2S)-3-oxo-2-(Propan-2-yl)butanedioate
(2S)-3-oxo-2-(Propan-2-yl)butanedioic acid
(3S)-2-oxo-3-(propan-2-yl)butanedioic acid
2-Isopropyl-3-oxosuccinic acid
2-oxo-4-Methyl-3-carboxypentanoate
2-oxo-4-Methyl-3-carboxypentanoic acid
3-Carboxy-4-methyl-2-oxopentanoate
3-Carboxy-4-methyl-2-oxopentanoic acid
seed.compound:cpd02605
seedM:cpd02605
2-isopropyl-3-oxosuccinate
(2S)-2-Isopropyl-3-oxosuccinate
(2S)-2-isopropyl-3-oxosuccinate
2-Oxo-4-methyl-3-carboxypentanoate
3-Carboxy-4-methyl-2-oxopentanoate
3c4mop
bigg.metabolite:3c4mop
biggM:3c4mop
3-Carboxy-4-methyl-2-oxopentanoate
hmdb:HMDB12149
chebi:11765
chebi:19975
biggM:M_3c4mop
keggC:M_C04236
seedM:M_cpd02605
secondary/obsolete/fantasy identifier