Feedback

(2S)-2-isopropyl-3-oxosuccinate

Properties
MNX_IDMNXM1602
formulaC7H8O5
charge-2
mass172.13542
referencechebi:17214
Image of MNXM1602
InChIKeyHIIZAGQWABAMRR-BYPYZUCNSA-L
InChIInChI=1S/C7H10O5/c1-3(2)4(6(9)10)5(8)7(11)12/h3-4H,1-2H3,(H,9,10)(H,11,12)/p-2/t4-/m0/s1
SMILESCC(C)[C@H](C([O-])=O)C(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
biggM:3c4mop 3-Carboxy-4-methyl-2-oxopentanoate
metacycM:CPD-7100 (2S)-2-isopropyl-3-oxosuccinate
2-isopropyl-3-oxosuccinate
chebi:1467 (2S)-2-isopropyl-3-oxosuccinic acid
(2S)-2-(1-methylethyl)-3-oxobutanedioic acid
(2S)-2-Isopropyl-3-oxosuccinate
(2S)-3-oxo-2-(propan-2-yl)butanedioic acid
3-Carboxy-4-methyl-2-oxopentanoate
hmdb:HMDB0012149 2-Isopropyl-3-oxosuccinate
(2S)-2-(1-Methylethyl)-3-oxobutanedioate
(2S)-2-(1-Methylethyl)-3-oxobutanedioic acid
(2S)-2-Isopropyl-3-oxosuccinate
(2S)-2-Isopropyl-3-oxosuccinic acid
(2S)-2-isopropyl-3-oxobutanedioic acid
(2S)-3-oxo-2-(Propan-2-yl)butanedioate
(2S)-3-oxo-2-(Propan-2-yl)butanedioic acid
(3S)-2-oxo-3-(propan-2-yl)butanedioic acid
2-Isopropyl-3-oxosuccinic acid
2-oxo-4-Methyl-3-carboxypentanoate
2-oxo-4-Methyl-3-carboxypentanoic acid
3-Carboxy-4-methyl-2-oxopentanoate
3-Carboxy-4-methyl-2-oxopentanoic acid
seedM:cpd02605 2-isopropyl-3-oxosuccinate
(2S)-2-Isopropyl-3-oxosuccinate
(2S)-2-isopropyl-3-oxosuccinate
2-Oxo-4-methyl-3-carboxypentanoate
3-Carboxy-4-methyl-2-oxopentanoate
3c4mop
chebi:17214 (2S)-2-isopropyl-3-oxosuccinate
(2S)-2-isopropyl-3-oxosuccinate(2-)
(2S)-3-oxo-2-(propan-2-yl)butanedioate
biggM:M_3c4mop
chebi:11765
chebi:19975
hmdb:HMDB12149
keggC:M_C04236
seedM:M_cpd02605
secondary/obsolete/fantasy identifier
keggC:C04236 (2S)-2-Isopropyl-3-oxosuccinate
2-Oxo-4-methyl-3-carboxypentanoate
3-Carboxy-4-methyl-2-oxopentanoate