Feedback

 

1-pyrroline-5-carboxylate

Image of MNXM1617
Properties
MNX_IDMNXM1617
formulaC5H6NO2
charge-1
mass112.1072
referencechebi:15893
InChIKeyDWAKNKKXGALPNW-UHFFFAOYSA-M
InChIInChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/p-1
SMILES[O-]C(=O)C1CCC=N1

This chemical compound does not exist in my selection



Occurrences of 1-pyrroline-5-carboxylate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:1pyr5c 1-Pyrroline-5-carboxylate
chebi:11297
chebi:11689
chebi:15893
chebi:19095
chebi:19873
chebi:26458
chebi:29066
1-pyrroline-5-carboxylate
3,4-dihydro-2H-pyrrole-2-carboxylate
DWAKNKKXGALPNW-UHFFFAOYSA-M
chebi:1372 1-pyrroline-5-carboxylic acid
3,4-Dihydro-2H-Pyrrole-2-carboxylate
3,4-dihydro-2H-pyrrole-2-carboxylic acid
DWAKNKKXGALPNW-UHFFFAOYSA-N
Delta(1)-pyrroline-5-carboxylic acid
chebi:12409
chebi:17388
chebi:18727
(2S)-3,4-dihydro-2H-pyrrole-2-carboxylate
(S)-1-pyrroline-5-carboxylate
DWAKNKKXGALPNW-BYPYZUCNSA-M
S-1-pyrroline-5-carboxylate
chebi:371 (2S)-3,4-dihydro-2H-pyrrole-2-carboxylic acid
(S)-1-Pyrroline-5-carboxylate
(S)-1-pyrroline-5-carboxylic acid
1-Pyrroline-5-carboxylate
DWAKNKKXGALPNW-BYPYZUCNSA-N
L-1-Pyrroline-5-carboxylate
hmdb:HMDB01301
hmdb:HMDB02240
1-Pyrroline-5-carboxylic acid
1-pyrroline-5-carboxylic acid
3,4-dihydro-2H-pyrrole-2-carboxylic acid
kegg:C03912 (S)-1-Pyrroline-5-carboxylate
1-Pyrroline-5-carboxylate
L-1-Pyrroline-5-carboxylate
kegg:C04322 3,4-Dihydro-2H-Pyrrole-2-carboxylate
Delta1-Pyrroline-5-carboxylate
metacyc:L-DELTA1-PYRROLINE_5-CARBOXYLATE (S)-1-pyrroline-5-carboxylate
1-pyrroline-5-carboxylate
L-1-pyrroline-5-carboxylate
L-DELTA1-PYRROLINE_5-CARBOXYLATE
L-delta1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylic acid
pyrroline 5-carboxylate
reactome:113590
reactome:35305
(S)-1-pyrroline-5-carboxylate
1-Pyrroline-5-carboxylic acid
1PYR-5COOH
L-1-Pyrroline-5-carboxylate
sabiork:6942 (S)-1-Pyrroline-5-carboxylate
1-Pyrroline-5-carboxylate
L-1-Pyrroline-5-carboxylate
P5C
seed:cpd02431 (S)-1-Pyrroline-5-carboxylate
1-Pyrroline-5-carboxylate
1pyr5c
L-1-Pyrroline-5-carboxylate
sabiork:7234
seed:cpd02651
3,4-Dihydro-2H-Pyrrole-2-carboxylate
seed:cpd29655 (S)-1-pyrroline-5-carboxylate
1-pyrroline-5-carboxylate
L-1-pyrroline-5-carboxylate
L-delta1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylic acid
pyrroline 5-carboxylate
deprecated:MNXM301
deprecated:MNXM89898