Feedback

(S)-1-pyrroline-5-carboxylate

PropertiesImageOccurences in reactions
MNX_IDMNXM1617Image of MNXM1617
#reac
in my sandbox 0
in MNXref (generic)38
in models (compartimentalized) 22
formulaC5H6NO2
charge-1
mass112.10668
referencechebi:17388
InChIKeyDWAKNKKXGALPNW-BYPYZUCNSA-M
InChIInChI=1S/C5H7NO2/c7-5(8)4-2-1-3-6-4/h3-4H,1-2H2,(H,7,8)/p-1/t4-/m0/s1
SMILES[O-]C(=O)[C@@H]1CCC=N1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-113590
reactomeM:R-ALL-113590
reactome:R-ALL-35305
reactomeM:R-ALL-35305
CHEBI:17388
chebi:17388
(S)-1-pyrroline-5-carboxylate
(2S)-3,4-dihydro-2H-pyrrole-2-carboxylate
S-1-pyrroline-5-carboxylate
kegg.compound:C03912
keggC:C03912
(S)-1-Pyrroline-5-carboxylate
1-Pyrroline-5-carboxylate
L-1-Pyrroline-5-carboxylate
sabiork.compound:6942
sabiorkM:6942
(S)-1-Pyrroline-5-carboxylate
L-1-Pyrroline-5-carboxylate
P5C
metacyc.compound:L-DELTA1-PYRROLINE_5-CARBOXYLATE
metacycM:L-DELTA1-PYRROLINE_5-CARBOXYLATE
(S)-1-pyrroline-5-carboxylate
1-pyrroline-5-carboxylate
L-1-pyrroline-5-carboxylate
L-Delta1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylic acid
pyrroline 5-carboxylate
seed.compound:cpd29655
seedM:cpd29655
(S)-1-pyrroline-5-carboxylate
1-pyrroline-5-carboxylate
L-1-pyrroline-5-carboxylate
L-delta1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylic acid
pyrroline 5-carboxylate
CHEBI:371
chebi:371
(S)-1-pyrroline-5-carboxylic acid
(2S)-3,4-dihydro-2H-pyrrole-2-carboxylic acid
(S)-1-Pyrroline-5-carboxylate
1-Pyrroline-5-carboxylate
L-1-Pyrroline-5-carboxylate
bigg.metabolite:1pyr5c
biggM:1pyr5c
1-Pyrroline-5-carboxylate
seed.compound:cpd02431
seedM:cpd02431
1-Pyrroline-5-carboxylate
(S)-1-Pyrroline-5-carboxylate
(S)-1-pyrroline-5-carboxylate
1-pyrroline-5-carboxylate
1pyr5c
L-1-Pyrroline-5-carboxylate
L-1-pyrroline-5-carboxylate
L-delta1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylate
delta-1-pyrroline-5-carboxylic acid
pyrroline 5-carboxylate
hmdb:HMDB0001301 1-Pyrroline-5-carboxylic acid
(S)-1-Pyrroline-5-carboxylate
1-Pyrroline-5-carboxylate
1-pyrroline-5-carboxylic acid
3,4-dihydro-2H-Pyrrole-2-carboxylate
3,4-dihydro-2H-Pyrrole-2-carboxylic acid
3,4-dihydro-2H-pyrrole-2-carboxylic acid
D1-Pyrroline-5-carboxylate
D1-Pyrroline-5-carboxylic acid
DL-1-Pyrroline-5-carboxylate
DL-1-Pyrroline-5-carboxylic acid
Delta(1)-Pyrroline-5-carboxylic acid
L-1-Pyrroline-5-carboxylate
L-delta 1-Pyrroline-5-carboxylate
Pyrroline 5-carboxylate
Pyrroline-5-carboxylate
delta(1)-Pyrroline-5-carboxylate
delta(1)-pyrroline-5-carboxylate
delta(1)-pyrroline-5-carboxylic acid
delta(1)Pyrroline-5-carboxylate
delta-1-Pyrroline-5-carboxylate
delta-1-Pyrroline-5-carboxylate, (+-)-isomer
delta-1-Pyrroline-5-carboxylate, 14C-labeled, (+-)-isomer
delta-1-Pyrroline-5-carboxylic acid
CHEBI:15893
chebi:15893
1-pyrroline-5-carboxylate
3,4-dihydro-2H-pyrrole-2-carboxylate
CHEBI:1372
chebi:1372
1-pyrroline-5-carboxylic acid
3,4-Dihydro-2H-Pyrrole-2-carboxylate
3,4-dihydro-2H-pyrrole-2-carboxylic acid
Delta(1)-pyrroline-5-carboxylic acid
sabiork.compound:7234
sabiorkM:7234
3,4-Dihydro-2H-Pyrrole-2-carboxylate
1-Pyrroline-5-carboxylate
Delta1-Pyrroline-5-carboxylate
seed.compound:cpd02651
seedM:cpd02651
3,4-Dihydro-2H-Pyrrole-2-carboxylate
3,4-dihydro-2H-pyrrole-2-carboxylate
delta-1-Pyrroline-5-carboxylate
kegg.compound:C04322
keggC:C04322
Delta1-Pyrroline-5-carboxylate
3,4-Dihydro-2H-Pyrrole-2-carboxylate
hmdb:HMDB0002240
hmdb:HMDB01301
hmdb:HMDB02240
chebi:11297
chebi:11689
chebi:12409
chebi:18727
chebi:19095
chebi:19873
chebi:26458
biggM:M_1pyr5c
keggC:M_C03912
keggC:M_C04322
seedM:M_cpd02431
seedM:M_cpd02651
seedM:M_cpd29655
secondary/obsolete/fantasy identifier