This is version 4.2 of MetaNetX/MNXref
 Feedback

D-threo-isocitrate

PropertiesImageOccurences in reactions
MNX_IDMNXM162Image of MNXM162
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 0
formulaC6H5O7
charge-3
mass189.0997
referencechebi:15562
InChIKeyODBLHEXUDAPZAU-ZAFYKAAXSA-K
InChIInChI=1S/C6H8O7/c7-3(8)1-2(5(10)11)4(9)6(12)13/h2,4,9H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3/t2-,4+/m0/s1
SMILESO[C@H]([C@H](CC([O-])=O)C([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15562
chebi:15562
D-threo-isocitrate
(1R,2S)-1-hydroxypropane-1,2,3-tricarboxylate
D-threo-isocitrate(3-)
threo-Ds-isocitrate
kegg.compound:C00451
keggC:C00451
(1R,2S)-1-Hydroxypropane-1,2,3-tricarboxylate
D-threo-Isocitric acid
sabiork.compound:31102
sabiorkM:31102
D-threo-Isocitrate
(2R,3S)-Isocitrate
hmdb:HMDB0001874 D-threo-Isocitric acid
(+)-threo-Isocitrate
(+)-threo-Isocitric acid
(1R,2S)-1-Hydroxypropane-1,2,3-tricarboxylate
(1R,2S)-1-Hydroxypropane-1,2,3-tricarboxylic acid
(1R,2S)-1-hydroxypropane-1,2,3-tricarboxylic acid
(2R,3S)-Isocitrate
3-Carboxy-2,3-dideoxy-L-threo-pentaric acid
D-(+)-threo-Isocitric acid(2R,3S)-isocitric acid
D-threo-Isocitrate
DS-threo-Isocitrate
DS-threo-Isocitric acid
ICI
ICT
ISOCITRIC ACID
ISOCITRate
Isocitric acid, (11)C-labeled
Isocitric acid, calcium salt
Isocitric acid, disodium salt
Isocitric acid, potassium salt
Isocitric acid, sodium salt
Isocitric acid, trisodium salt
threo-D-(+)-Isocitrate
threo-D-(+)-Isocitric acid
threo-DS(+)-Isocitrate
threo-DS(+)-Isocitric acid
threo-DS(+)-isocitrate
threo-Isocitrate
seed.compound:cpd00353
seedM:cpd00353
D-threo-Isocitric acid
(1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate
(1R,2S)-1-Hydroxypropane-1,2,3-tricarboxylate
D-isocitrate
D-threo-isocitrate
D-threo-isocitric acid
I-CIT
isocitrate
isocitric acid
threo-Ds-isocitrate
metacyc.compound:THREO-DS-ISO-CITRATE
metacycM:THREO-DS-ISO-CITRATE
D-threo-isocitrate
(1R, 2S)-1-hydroxypropane-1,2,3-tricarboxylate
D-isocitrate
D-threo-isocitric acid
I-CIT
isocitrate
isocitric acid
threo-Ds-isocitrate
reactome:R-ALL-29938
reactomeM:R-ALL-29938
reactome:R-ALL-389545
reactomeM:R-ALL-389545
reactome:R-ALL-389548
reactomeM:R-ALL-389548
CHEBI:151
chebi:151
D-threo-isocitric acid
(+)-threo-isocitric acid
(1R,2S)-1-hydroxypropane-1,2,3-tricarboxylic acid
3-carboxy-2,3-dideoxy-L-threo-pentaric acid
D-threo-Isocitric acid
ISOCITRIC ACID
hmdb:HMDB01874
chebi:10827
chebi:18510
keggC:M_C00451
seedM:M_cpd00353
secondary/obsolete/fantasy identifier