Feedback

3,4-dihydroxy-2-methyl-1-oxo-4-[(2E,6E)-farnesyl]-3,4-dihydroquinoline 1-oxide

PropertiesImageOccurences in reactions
MNX_IDMNXM162452Image of MNXM162452
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 0
formulaC25H35NO3
charge0
mass397.26169
referencechebi:90786
InChIKeyQONKLYKAMCVBLM-YEFHWUCQSA-N
InChIInChI=1S/C25H35NO3/c1-18(2)10-8-11-19(3)12-9-13-20(4)16-17-25(28)22-14-6-7-15-23(22)26(29)21(5)24(25)27/h6-7,10,12,14-16,24,27-28H,8-9,11,13,17H2,1-5H3/b19-12+,20-16+
SMILESCC(C)=CCC/C(C)=C/CC/C(C)=C/CC1(O)c2ccccc2[N+]([O-])=C(C)C1O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:90786
chebi:90786
3,4-dihydroxy-2-methyl-1-oxo-4-[(2E,6E)-farnesyl]-3,4-dihydroquinoline 1-oxide
2-methyl-1-oxo-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-3,4-dihydro-1lambda(5)-quinoline-3,4-diol
2-methyl-1-oxo-4-[(2E,6E)-farnesyl]-3,4-dihydroquinoline-3,4-diol
3,4-dihydroxy-2-methyl-4-farnesyl-3H-quinolin-1-ium-1-olate
4-farnesyl-2-methyl-1-oxo-3,4-dihydroquinoline-3,4-diol
kegg.compound:C21142
keggC:C21142
3,4-Dihydroxy-2-methy-4-[(2E,6E)-farnesyl]-3,4-dihydroquinoline 1-oxide
metacyc.compound:CPD-18736
metacycM:CPD-18736
seed.compound:cpd36035
seedM:cpd36035
3,4-dihydroxy-2-methyl-4-farnesyl-3H-quinolin-1-ium-1-olate
keggC:M_C21142
seedM:M_cpd36035
secondary/obsolete/fantasy identifier