Feedback

3''-deamino-3''-oxonicotianamine

PropertiesImageOccurences in reactions
MNX_IDMNXM1631Image of MNXM1631
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 0
formulaC12H16N2O7
charge-2
mass300.26472
referencechebi:58685
InChIKeyPSBHIGYNXQIUQY-YUMQZZPRSA-L
InChIInChI=1S/C12H18N2O7/c15-9(12(20)21)1-4-13-7(10(16)17)2-5-14-6-3-8(14)11(18)19/h7-8,13H,1-6H2,(H,16,17)(H,18,19)(H,20,21)/p-2/t7-,8-/m0/s1
SMILES[O-]C(=O)[C@H](CCN1CC[C@H]1C([O-])=O)[NH2+]CCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58685
chebi:58685
3''-deamino-3''-oxonicotianamine
(2S)-1-{(3S)-3-carboxylato-3-[(3-carboxylato-3-oxopropyl)azaniumyl]propyl}azetidinium-2-carboxylate
3''-deamino-3''-oxonicotianaminium(1-)
kegg.compound:C15486
keggC:C15486
3''-Deamino-3''-oxonicotianamine
seed.compound:cpd11173
seedM:cpd11173
3''-Deamino-3''-oxonicotianamine
3''-deamino-3''-oxonicotianamine
metacyc.compound:CPD-7228
metacycM:CPD-7228
3''-deamino-3''-oxonicotianamine
CHEBI:38160
chebi:38160
3''-deamino-3''-oxonicotianamine
(2S)-1-{(3S)-3-carboxy-3-[(3-carboxy-3-oxopropyl)amino]propyl}azetidine-2-carboxylic acid
keggC:M_C15486
seedM:M_cpd11173
secondary/obsolete/fantasy identifier