Feedback

3,4-dihydroxyphenylglycolaldehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM1633Image of MNXM1633
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 7
formulaC8H8O4
charge0
mass168.04226
referencemetacycM:DIHYDROXYPHENYLGLYCOLALDEHYDE
InChIKeyYUGMCLJIWGEKCK-QMMMGPOBSA-N
InChIInChI=1S/C8H8O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-4,8,10-12H/t8-/m0/s1
SMILESO=C[C@H](O)c1ccc(O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
metacyc.compound:DIHYDROXYPHENYLGLYCOLALDEHYDE
metacycM:DIHYDROXYPHENYLGLYCOLALDEHYDE
3,4-dihydroxyphenylglycolaldehyde
3,4-dihydroxymandelaldehyde
3,4-dihydroxymandelic aldehyde
DHMAL
DHPGALD
DOPEGAL
benzeneacetaldehyde, alpha,3,4-trihydroxy-
bigg.metabolite:34dhmald
biggM:34dhmald
3,4-Dihydroxymandelaldehyde
hmdb:HMDB0006242 3,4-Dihydroxymandelaldehyde
2-(3,4-dihydroxyphenyl)-2-hydroxyacetaldehyde
3,4-Dihydroxymandelic aldehyde
3,4-Dihydroxyphenylglycolaldehyde
3,4-Dihydroxyphenylglycolic aldehyde
DHMAL
DHPGALD
DOPEGAL
a,3,4-Trihydroxy-benzeneacetaldehyde
a,3,4-Trihydroxybenzeneacetaldehyde
a,3,4-Trihydroxyphenylacetaldehyde
alpha,3,4-Trihydroxy-benzeneacetaldehyde
alpha,3,4-Trihydroxybenzeneacetaldehyde
alpha,3,4-Trihydroxyphenylacetaldehyde
alpha,3,4-trihydroxybenzeneacetaldehyde
alpha,3,4-trihydroxyphenylacetaldehyde
dhmal
kegg.compound:C05577
keggC:C05577
3,4-Dihydroxymandelaldehyde
3,4-Dihydroxyphenylglycolaldehyde
seed.compound:cpd03307
seedM:cpd03307
3,4-Dihydroxymandelaldehyde
3,4-Dihydroxyphenylglycolaldehyde
3,4-dihydroxymandelaldehyde
3,4-dihydroxymandelic aldehyde
3,4-dihydroxyphenylglycolaldehyde
DHMAL
DHPGALD
DOPEGAL
benzeneacetaldehyde, alpha,3,4-trihydroxy-
sabiork.compound:26613
sabiorkM:26613
3,4-Dihydroxyphenylglycolaldehyde
CHEBI:27852
chebi:27852
3,4-dihydroxymandelaldehyde
3,4-Dihydroxyphenylglycolaldehyde
3,4-dihydroxymandelic aldehyde
3,4-dihydroxyphenylglycolic aldehyde
DHMAL
DHPGALD
DOPEGAL
alpha,3,4-trihydroxybenzeneacetaldehyde
alpha,3,4-trihydroxyphenylacetaldehyde
hmdb:HMDB0004057
hmdb:HMDB04057
hmdb:HMDB06242
chebi:1382
chebi:19883
biggM:M_34dhmald
keggC:M_C05577
seedM:M_cpd03307
secondary/obsolete/fantasy identifier