Feedback

3,4-dihydroxyphenylglycolaldehyde

Properties
MNX_IDMNXM1633
formulaC8H8O4
charge0
mass168.14672
referencemetacycM:DIHYDROXYPHENYLGLYCOLALDEHYDE
Image of MNXM1633
InChIKeyYUGMCLJIWGEKCK-QMMMGPOBSA-N
InChIInChI=1S/C8H8O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-4,8,10-12H/t8-/m0/s1
SMILESO[C@@H](C=O)c1ccc(O)c(O)c1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models7

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0006242 3,4-Dihydroxymandelaldehyde
2-(3,4-dihydroxyphenyl)-2-hydroxyacetaldehyde
3,4-Dihydroxymandelic aldehyde
3,4-Dihydroxyphenylglycolaldehyde
3,4-Dihydroxyphenylglycolic aldehyde
DHMAL
DHPGALD
DOPEGAL
a,3,4-Trihydroxy-benzeneacetaldehyde
a,3,4-Trihydroxybenzeneacetaldehyde
a,3,4-Trihydroxyphenylacetaldehyde
alpha,3,4-Trihydroxy-benzeneacetaldehyde
alpha,3,4-Trihydroxybenzeneacetaldehyde
alpha,3,4-Trihydroxyphenylacetaldehyde
alpha,3,4-trihydroxybenzeneacetaldehyde
alpha,3,4-trihydroxyphenylacetaldehyde
dhmal
chebi:27852 3,4-dihydroxymandelaldehyde
3,4-Dihydroxyphenylglycolaldehyde
3,4-dihydroxymandelic aldehyde
3,4-dihydroxyphenylglycolic aldehyde
DHMAL
DHPGALD
DOPEGAL
alpha,3,4-trihydroxybenzeneacetaldehyde
alpha,3,4-trihydroxyphenylacetaldehyde
biggM:M_34dhmald
chebi:1382
chebi:19883
hmdb:HMDB0004057
hmdb:HMDB04057
hmdb:HMDB06242
keggC:M_C05577
seedM:M_cpd03307
secondary/obsolete/fantasy identifier
seedM:cpd03307 3,4-Dihydroxymandelaldehyde
3,4-Dihydroxyphenylglycolaldehyde
3,4-dihydroxymandelaldehyde
3,4-dihydroxymandelic aldehyde
3,4-dihydroxyphenylglycolaldehyde
DHMAL
DHPGALD
DOPEGAL
benzeneacetaldehyde, alpha,3,4-trihydroxy-
metacycM:DIHYDROXYPHENYLGLYCOLALDEHYDE 3,4-dihydroxyphenylglycolaldehyde
3,4-dihydroxymandelaldehyde
3,4-dihydroxymandelic aldehyde
DHMAL
DHPGALD
DOPEGAL
benzeneacetaldehyde, alpha,3,4-trihydroxy-
sabiorkM:26613 3,4-Dihydroxyphenylglycolaldehyde
keggC:C05577 3,4-Dihydroxymandelaldehyde
3,4-Dihydroxyphenylglycolaldehyde
biggM:34dhmald 3,4-Dihydroxymandelaldehyde