Feedback

 

3-(3-hydroxyphenyl)propanoate

Image of MNXM1634
Properties
MNX_IDMNXM1634
formulaC9H9O3
charge-1
mass165.1665
referencechebi:57277
InChIKeyQVWAEZJXDYOKEH-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12)/p-1
SMILESOc1cccc(CCC([O-])=O)c1

This chemical compound does not exist in my selection



Occurrences of 3-(3-hydroxyphenyl)propanoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3hpppn 3-(3-hydroxy-phenyl)propionate
chebi:1427 3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-hydroxyphenyl)propanoic acid
3-(3-hydroxyphenyl)propionic acid
3-(m-hydroxyphenyl)propionic acid
Dihydro-3-coumaric acid
QVWAEZJXDYOKEH-UHFFFAOYSA-N
beta-(m-hydroxyphenyl)propionic acid
chebi:57277 3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propionate
QVWAEZJXDYOKEH-UHFFFAOYSA-M
hmdb:HMDB00375 3-(3-Hydroxyphenyl)propanoic acid
3-(3-hydroxyphenyl)propanoic acid
3-hydroxyphenylpropionic acid
kegg:C11457 3-(3-Hydroxyphenyl)propanoate
3-(3-Hydroxyphenyl)propanoic acid
3-Hydroxyphenylpropanoate
Dihydro-3-coumaric acid
metacyc:3-HYDROXYPHENYL-PROPIONATE 3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propanoic acid
3-(3-hydroxyphenyl)propionate
3-(3-hydroxyphenyl)propionic acid
3-HYDROXYPHENYL-PROPIONATE
3HPP
MHP
dihydro-3-coumarate
m-hydroxyphenylpropionate
m-hydroxyphenylpropionic acid
seed:cpd08304 3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-hydroxy-phenyl)propionate
3-Hydroxyphenylpropanoate
3hpppn
Dihydro-3-coumaric acid