Feedback

3-(3-hydroxyphenyl)propanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1634Image of MNXM1634
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 9
formulaC9H9O3
charge-1
mass165.05572
referencechebi:57277
InChIKeyQVWAEZJXDYOKEH-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12)/p-1
SMILESO=C([O-])CCc1cccc(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57277
chebi:57277
3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propionate
hmdb:HMDB0000375 3-(3-Hydroxyphenyl)propanoic acid
1-Amino-3-(phosphohydroxy)propan-2-one
1-Amino-propan-2-one-3-phosphate
17 Hydroxyprogesterone
17 alpha Hydroxyprogesterone
17 alpha-Hydroxyprogesterone
17-Hydroxypregn-4-en-3,20-dione
17-Hydroxypregn-4-ene-3,20-dione
17-Hydroxyprogesterone, (17 alpha)-isomer
17-Hydroxyprogesterone, (9 beta, 10 alpha)-isomer
17-OH Progesterone
17-OHP
17-alpha-Hydroxyprogesterone
17a-Hydroxy-4-pregnene-3,20-dione
17a-Hydroxy-progesterone
17a-Hydroxypregn-4-ene-3,20-dione
17a-Hydroxyprogesterone
17alpha-Hydroxy-4-pregnene-3,20-dione
17alpha-Hydroxy-progesterone
17alpha-Hydroxyprogesterone
17alpha-hydroxy-4-pregnene-3,20-dione
17alpha-hydroxy-progesterone
2-AP3
2-Amino-3-phosphono-propanoate
2-Amino-3-phosphono-propanoic acid
2-Amino-3-phosphono-propionate
2-Amino-3-phosphono-propionic acid
2-Amino-3-phosphonopropanoate
2-Amino-3-phosphonopropanoic acid
2-Amino-3-phosphonopropionate
2-Amino-3-phosphonopropionic acid, (DL)-isomer
2-Amino-3-phosphonopropionic acid, sodium salt
2-Amino-3-phosphopropionate
2-Amino-3-phosphopropionic acid
2-Amino-3-phosprop
2-Azanyl-3-phosphono-propanoate
2-Azanyl-3-phosphono-propanoic acid
3-(3-Hydroxy-phenyl)-propanoate
3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-Hydroxy-phenyl)-propionic acid
3-(3-Hydroxyphenyl)propanoate
3-(3-Hydroxyphenyl)propionate
3-(3-Hydroxyphenyl)propionic acid
3-(3-hydroxyphenyl)propanoic acid
3-(m-Hydroxyphenyl)propionate
3-(m-Hydroxyphenyl)propionic acid
3-Amino-2-oxopropyl phosphate
3-Hydroxybenzenepropanoate
3-Hydroxybenzenepropanoic acid
3-Hydroxydihydrocinnamate
3-Hydroxydihydrocinnamic acid
3-Hydroxyhydrocinnamic acid
3-Hydroxyphenylpropanoate
3-Hydroxyphenylpropanoic acid
3-Hydroxyphenylpropionate
3-Hydroxyphenylpropionic acid
3-hydroxyphenylpropionic acid
D-Alanyl-phosphate
D4-Pregnen-17a-ol-3,20-dione
Dihydro-3-coumarate
Dihydro-3-coumaric acid
Dihydro-3-coumaric acid, monosodium salt
Dihydro-m-coumaric acid
Gestageno
Gestageno gador
Glyphosate
Hidroxiprogesterona
Hydralazine pyruvic acid hydrazone
Hydroxyprogesterone
Hydroxyprogesteronum
L-AP3
Phosphonoalanine
Pregn-4-en-17a-ol-3,20-dione
Pregn-4-ene-3,20-dione-17-ol
Prodix
Prodox
b-(3-Hydroxyphenyl)propionate
b-(3-Hydroxyphenyl)propionic acid
b-(m-Hydroxyphenyl)propionate
b-(m-Hydroxyphenyl)propionic acid
beta-(3-Hydroxyphenyl)propionate
beta-(3-Hydroxyphenyl)propionic acid
beta-(m-Hydroxyphenyl)propionate
beta-(m-Hydroxyphenyl)propionic acid
beta-(m-hydroxyphenyl)propionate
beta-(m-hydroxyphenyl)propionic acid
delta(4)-Pregnene-17a-ol-3,20-dione
delta(4)-Pregnene-17alpha-ol-3,20-dione
delta(4)-pregnene-17a-ol-3,20-dione
delta(4)-pregnene-17alpha-ol-3,20-dione
dihydro-m-Coumarate
m-Hydrocoumaric acid
m-Hydroxy-hydrocinnamate
m-Hydroxy-hydrocinnamic acid
m-Hydroxyphenylpropionate
m-Hydroxyphenylpropionic acid
kegg.compound:C11457
keggC:C11457
3-(3-Hydroxyphenyl)propanoic acid
3-(3-Hydroxyphenyl)propanoate
3-Hydroxyphenylpropanoate
Dihydro-3-coumaric acid
bigg.metabolite:3hpppn
biggM:3hpppn
3-(3-hydroxy-phenyl)propionate
metacyc.compound:3-HYDROXYPHENYL-PROPIONATE
metacycM:3-HYDROXYPHENYL-PROPIONATE
3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propanoic acid
3-(3-hydroxyphenyl)propionate
3-(3-hydroxyphenyl)propionic acid
3HPP
MHP
dihydro-3-coumarate
m-hydroxyphenylpropionate
m-hydroxyphenylpropionic acid
CHEBI:1427
chebi:1427
3-(3-hydroxyphenyl)propanoic acid
3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-hydroxyphenyl)propionic acid
3-(m-hydroxyphenyl)propionic acid
Dihydro-3-coumaric acid
beta-(m-hydroxyphenyl)propionic acid
seed.compound:cpd08304
seedM:cpd08304
Dihydro-3-coumaric acid
3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-Hydroxyphenyl)propanoate
3-(3-Hydroxyphenyl)propanoic acid
3-(3-hydroxy-phenyl)propionate
3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propanoic acid
3-(3-hydroxyphenyl)propionate
3-(3-hydroxyphenyl)propionic acid
3-Hydroxyphenylpropanoate
3HPP
3hpppn
MHP
dihydro-3-coumarate
m-hydroxyphenylpropionate
m-hydroxyphenylpropionic acid
hmdb:HMDB00375
biggM:M_3hpppn
keggC:M_C11457
seedM:M_cpd08304
secondary/obsolete/fantasy identifier