Feedback

3-(3-hydroxyphenyl)propanoate

Properties
MNX_IDMNXM1634
formulaC9H9O3
charge-1
mass165.16596
referencechebi:57277
Image of MNXM1634
InChIKeyQVWAEZJXDYOKEH-UHFFFAOYSA-M
InChIInChI=1S/C9H10O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-3,6,10H,4-5H2,(H,11,12)/p-1
SMILESOc1cccc(CCC([O-])=O)c1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref6
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd08304 Dihydro-3-coumaric acid
3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-Hydroxyphenyl)propanoate
3-(3-Hydroxyphenyl)propanoic acid
3-(3-hydroxy-phenyl)propionate
3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propanoic acid
3-(3-hydroxyphenyl)propionate
3-(3-hydroxyphenyl)propionic acid
3-Hydroxyphenylpropanoate
3HPP
3hpppn
MHP
dihydro-3-coumarate
m-hydroxyphenylpropionate
m-hydroxyphenylpropionic acid
keggC:C11457 3-(3-Hydroxyphenyl)propanoic acid
3-(3-Hydroxyphenyl)propanoate
3-Hydroxyphenylpropanoate
Dihydro-3-coumaric acid
chebi:57277 3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propionate
metacycM:3-HYDROXYPHENYL-PROPIONATE 3-(3-hydroxyphenyl)propanoate
3-(3-hydroxyphenyl)propanoic acid
3-(3-hydroxyphenyl)propionate
3-(3-hydroxyphenyl)propionic acid
3HPP
MHP
dihydro-3-coumarate
m-hydroxyphenylpropionate
m-hydroxyphenylpropionic acid
chebi:1427 3-(3-hydroxyphenyl)propanoic acid
3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-hydroxyphenyl)propionic acid
3-(m-hydroxyphenyl)propionic acid
Dihydro-3-coumaric acid
beta-(m-hydroxyphenyl)propionic acid
biggM:M_3hpppn
hmdb:HMDB00375
keggC:M_C11457
seedM:M_cpd08304
secondary/obsolete/fantasy identifier
biggM:3hpppn 3-(3-hydroxy-phenyl)propionate
hmdb:HMDB0000375 3-(3-Hydroxyphenyl)propanoic acid
3-(3-Hydroxy-phenyl)-propanoate
3-(3-Hydroxy-phenyl)-propanoic acid
3-(3-Hydroxy-phenyl)-propionic acid
3-(3-Hydroxyphenyl)propanoate
3-(3-Hydroxyphenyl)propionate
3-(3-Hydroxyphenyl)propionic acid
3-(3-hydroxyphenyl)propanoic acid
3-(m-Hydroxyphenyl)propionate
3-(m-Hydroxyphenyl)propionic acid
3-Hydroxybenzenepropanoate
3-Hydroxybenzenepropanoic acid
3-Hydroxydihydrocinnamate
3-Hydroxydihydrocinnamic acid
3-Hydroxyhydrocinnamic acid
3-Hydroxyphenylpropanoate
3-Hydroxyphenylpropanoic acid
3-Hydroxyphenylpropionate
3-Hydroxyphenylpropionic acid
3-hydroxyphenylpropionic acid
b-(3-Hydroxyphenyl)propionate
b-(3-Hydroxyphenyl)propionic acid
b-(m-Hydroxyphenyl)propionate
b-(m-Hydroxyphenyl)propionic acid
beta-(3-Hydroxyphenyl)propionate
beta-(3-Hydroxyphenyl)propionic acid
beta-(m-Hydroxyphenyl)propionate
beta-(m-Hydroxyphenyl)propionic acid
beta-(m-hydroxyphenyl)propionate
beta-(m-hydroxyphenyl)propionic acid
dihydro-3-Coumarate
dihydro-3-Coumaric acid
dihydro-3-Coumaric acid, monosodium salt
dihydro-m-Coumarate
dihydro-m-Coumaric acid
m-Hydrocoumaric acid
m-Hydroxy-hydrocinnamate
m-Hydroxy-hydrocinnamic acid
m-Hydroxyphenylpropionate
m-Hydroxyphenylpropionic acid