Feedback

3-hydroxy-3-methyl-2-oxobutanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1638Image of MNXM1638
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 5
formulaC5H7O4
charge-1
mass131.10668
referencechebi:11812
InChIKeyDNOPJXBPONYBLB-UHFFFAOYSA-M
InChIInChI=1S/C5H8O4/c1-5(2,9)3(6)4(7)8/h9H,1-2H3,(H,7,8)/p-1
SMILESCC(C)(O)C(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:11812
chebi:11812
3-hydroxy-3-methyl-2-oxobutanoate
2-Oxo-3-hydroxyisovalerate
3-Hydroxy-3-methyl-2-oxobutanoate
seed.compound:cpd02569
seedM:cpd02569
2-Oxo-3-hydroxyisovalerate
2-oxo-3-hydroxyisovalerate
3-Hydroxy-3-methyl-2-oxobutanoate
3-Hydroxy-3-methyl-2-oxobutanoic acid
3-hydroxy-3-methyl-2-oxobutanoate
33hmeoxobut
bigg.metabolite:3hmoa
biggM:3hmoa
3-Hydroxy-3-methyl-2-oxobutanoic acid
kegg.compound:C04181
keggC:C04181
3-Hydroxy-3-methyl-2-oxobutanoic acid
2-Oxo-3-hydroxyisovalerate
3-Hydroxy-3-methyl-2-oxobutanoate
lipidmaps:LMFA01020277
lipidmapsM:LMFA01020277
3-hydroxy-3-methyl-2-oxo-butanoic acid
3-hydroxy-3-methyl-2-oxo-butanoic acid
FA(5:0(OH,Ke))
metacyc.compound:CPD-231
metacycM:CPD-231
3-hydroxy-3-methyl-2-oxobutanoate
2-oxo-3-hydroxyisovalerate
CHEBI:17667
chebi:17667
3-hydroxy-3-methyl-2-oxobutanoic acid
2-oxo-3-hydroxyisovaleric acid
3-Hydroxy-3-methyl-2-oxobutanoate
3-Hydroxy-3-methyl-2-oxobutanoic acid
envipath:...bd3ffebb023c
envipathM:...bd3ffebb023c
compound 1018
envipath:...ac55f96b9580
envipathM:...ac55f96b9580
compound 38801
chebi:1522
biggM:M_3hmoa
keggC:M_C04181
seedM:M_cpd02569
secondary/obsolete/fantasy identifier