Feedback

3-hydroxyphenylacetate

Properties
MNX_IDMNXM1639
formulaC8H7O3
charge-1
mass151.13938
referencechebi:58149
Image of MNXM1639
InChIKeyFVMDYYGIDFPZAX-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1
SMILESOc1cccc(CC([O-])=O)c1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref10
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd03320 3-Hydroxyphenylacetate
3-Hydroxyphenylacetic acid
3-hydroxyphenylacetate
3-hydroxyphenylacetic acid
m-hydroxyphenylacetate
m-hydroxyphenylacetic acid
sabiorkM:2819 3-Hydroxyphenylacetate
chebi:17445 3-hydroxyphenylacetic acid
(3-hydroxyphenyl)acetic acid
(m-hydroxyphenyl)acetic acid
3-Hydroxyphenylacetic acid
3-hydroxybenzeneacetic acid
m-hydroxyphenylacetic acid
biggM:3hoxpac 3 Hydroxyphenylacetic acid
chebi:58149 3-hydroxyphenylacetate
(3-hydroxyphenyl)acetate
3-hydroxyphenylacetate anion
3-hydroxyphenylacetate(1-)
keggC:C05593 3-Hydroxyphenylacetate
3-Hydroxyphenylacetic acid
biggM:M_3hoxpac
chebi:11833
chebi:1550
chebi:20076
chebi:39897
hmdb:HMDB00440
keggC:M_C05593
seedM:M_cpd03320
secondary/obsolete/fantasy identifier
metacycM:3-HYDROXYPHENYLACETATE 3-hydroxyphenylacetate
3-hydroxyphenylacetic acid
m-hydroxyphenylacetate
m-hydroxyphenylacetic acid
hmdb:HMDB0000440 3-Hydroxyphenylacetic acid
(3-Hydroxy-phenyl)-acetate
(3-Hydroxy-phenyl)-acetic acid
(m-Hydroxyphenyl)acetate
(m-Hydroxyphenyl)acetic acid
2-(3-hydroxyphenyl)acetic acid
3-Hydroxy-benzeneacetate
3-Hydroxy-benzeneacetic acid
3-Hydroxybenzeneacetate
3-Hydroxybenzeneacetic acid
3-Hydroxyphenylacetate
3-hydroxyphenylacetic acid
Meta-hydroxyphenylacetic acid
m-Hydroxyphenylacetate
m-Hydroxyphenylacetic acid