Feedback

 

3-hydroxyphenylacetate

Image of MNXM1639
Properties
MNX_IDMNXM1639
formulaC8H7O3
charge-1
mass151.1399
referencechebi:58149
InChIKeyFVMDYYGIDFPZAX-UHFFFAOYSA-M
InChIInChI=1S/C8H8O3/c9-7-3-1-2-6(4-7)5-8(10)11/h1-4,9H,5H2,(H,10,11)/p-1
SMILESOc1cccc(CC([O-])=O)c1

This chemical compound does not exist in my selection



Occurrences of 3-hydroxyphenylacetate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3hoxpac 3 Hydroxyphenylacetic acid
chebi:11833
chebi:1550
chebi:17445
chebi:20076
chebi:39897
(3-hydroxyphenyl)acetic acid
(m-hydroxyphenyl)acetic acid
3-Hydroxyphenylacetic acid
3-hydroxybenzeneacetic acid
3-hydroxyphenylacetic acid
FVMDYYGIDFPZAX-UHFFFAOYSA-N
m-hydroxyphenylacetic acid
chebi:58149 (3-hydroxyphenyl)acetate
3-hydroxyphenylacetate
3-hydroxyphenylacetate anion
3-hydroxyphenylacetate(1-)
FVMDYYGIDFPZAX-UHFFFAOYSA-M
hmdb:HMDB00440 2-(3-hydroxyphenyl)acetic acid
3-Hydroxyphenylacetic acid
3-hydroxyphenylacetic acid
kegg:C05593 3-Hydroxyphenylacetate
3-Hydroxyphenylacetic acid
metacyc:3-HYDROXYPHENYLACETATE 3-HYDROXYPHENYLACETATE
3-hydroxyphenylacetate
3-hydroxyphenylacetic acid
m-hydroxyphenylacetate
m-hydroxyphenylacetic acid
sabiork:2819
seed:cpd03320
3-Hydroxyphenylacetate