Feedback

4-hydroxybenzoate

PropertiesImageOccurences in reactions
MNX_IDMNXM164Image of MNXM164
#reac
in my sandbox 0
in MNXref (generic)85
in models (compartimentalized) 35
formulaC7H5O3
charge-1
mass137.02442
referencechebi:17879
InChIKeyFJKROLUGYXJWQN-UHFFFAOYSA-M
InChIInChI=1S/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10)/p-1
SMILESO=C([O-])c1ccc(O)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17879
chebi:17879
4-hydroxybenzoate
4-hydroxybenzoic acid, ion(1-)
p-hydroxybenzoate
bigg.metabolite:4hbz
biggM:4hbz
envipath:...785c0dc04bfa
envipathM:...785c0dc04bfa
4-Hydroxybenzoate
seed.compound:cpd00136
seedM:cpd00136
4-Hydroxybenzoate
4-Hydroxybenzoic Acid
4-Hydroxybenzoic acid
4-hydroxybenzoate
4hbz
Hydroxybenzenecarboxylic acid
Hydroxybenzoic acid
p-hydroxybenzoate
sabiork.compound:1951
sabiorkM:1951
kegg.compound:C00156
keggC:C00156
4-Hydroxybenzoate
4-Hydroxybenzoic acid
Hydroxybenzenecarboxylic acid
Hydroxybenzoic acid
hmdb:HMDB0000500 4-Hydroxybenzoic acid
4-Carboxyphenol
4-Hydroxy-benzoate
4-Hydroxy-benzoesaeure
4-Hydroxy-benzoic acid
4-Hydroxybenzoate
4-Hydroxybenzoic acid, calcium salt
4-Hydroxybenzoic acid, copper(2+)(1:1) salt
4-Hydroxybenzoic acid, dilithium salt
4-Hydroxybenzoic acid, dipotassium salt
4-Hydroxybenzoic acid, disodium salt
4-Hydroxybenzoic acid, monopotassium salt
4-Hydroxybenzoic acid, monosodium salt
4-Hydroxybenzoic acid, monosodium salt, 11C-labeled
4-hydroxybenzoic acid
Hydroxybenzenecarboxylate
Hydroxybenzenecarboxylic acid
Hydroxybenzoate
Hydroxybenzoic acid
P-hydroxybenzoic acid
Para-hydroxybenzoic acid
Paraben-acid
Sodium p-hydroxybenzoate tetrahydrate
p-Carboxyphenol
p-HYDROXYBENZOIC ACID
p-HYDROXYBENZOate
p-Hydroxy-benzoate
p-Hydroxy-benzoic acid
p-Salicylate
p-Salicylic acid
metacyc.compound:4-hydroxybenzoate
metacycM:4-hydroxybenzoate
4-hydroxybenzoate
4-hydroxybenzoic acid
p-hydroxybenzoate
reactome:R-ALL-2162213
reactomeM:R-ALL-2162213
CHEBI:30763
chebi:30763
4-hydroxybenzoic acid
4-Hydroxybenzoic acid
4-carboxyphenol
P-HYDROXYBENZOIC ACID
p-hydroxybenzoic acid
p-salicylic acid
envipath:...c660b8587741
envipathM:...c660b8587741
compound 131
envipath:...049369c47662
envipathM:...049369c47662
compound 37913
hmdb:HMDB00500
chebi:12003
chebi:1858
chebi:20397
chebi:20398
chebi:44949
biggM:M_4hbz
keggC:M_C00156
seedM:M_cpd00136
secondary/obsolete/fantasy identifier