Feedback

hexanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1653Image of MNXM1653
#reac
in my sandbox 0
in MNXref (generic)27
in models (compartimentalized) 30
formulaC6H11O2
charge-1
mass115.07645
referencechebi:17120
InChIKeyFUZZWVXGSFPDMH-UHFFFAOYSA-M
InChIInChI=1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8)/p-1
SMILESCCCCCC(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-444194
reactomeM:R-ALL-444194
CHEBI:17120
chebi:17120
hexanoate
1-hexanoate
1-pentacarboxylate
1-pentanecarboxylate
CH3-[CH2]4-COO(-)
butylacetate
caproate
capronate
hexoate
hexylate
n-caproate
n-hexanoate
n-hexoate
n-hexylate
nPnCO2 anion
pentanecarboxylate
pentylformate
bigg.metabolite:caproic
biggM:caproic
Caproic Acid
hmdb:HMDB0000535 Caproic acid
1-Hexanoate
1-Hexanoic acid
1-Pentanecarboxylate
1-Pentanecarboxylic acid
6:0
Bi(ohex)3
Bismuth(III)hexanoate
Butylacetate
Butylacetic acid
C6:0
CH3-[CH2]4-COOH
Calcium N-hexanoate
Calcium hexanoate
Caproate
Caproic acid sodium salt
Capronate
Capronic acid
FA(6:0)
Hexanoate
Hexanoic acid
Hexanoic acid, barium salt
Hexanoic acid, calcium salt
Hexanoic acid, copper (2+) salt
Hexanoic acid, manganese (2+) salt
Hexanoic acid, nickel (2+) salt
Hexanoic acid, potassium salt
Hexanoic acid, rhodium (2+) salt
Hexanoic acid, sodium salt
Hexanoic acid, sodium salt (1:1)
Hexanoic acid, sodium salt, 1-(11)C-labeled
Hexoate
Hexoic acid
Hexylate
Hexylic acid
N-Caproate
N-Caproic acid
N-Hexanoate
N-Hexanoic acid
N-Hexoate
N-Hexoic acid
N-Hexylate
N-Hexylic acid
Pentanecarboxylate
Pentanecarboxylic acid
Pentiformate
Pentiformic acid
Pentylformate
Pentylformic acid
Sodium caproate
Sodium capronate
Sodium hexanoate
hexanoic acid
lipidmaps:LMFA01010006
lipidmapsM:LMFA01010006
Caproic acid
Butylacetic acid
C6:0
Capronic acid
FA 6:0
Hexanoic acid
Pentylformic acid
bigg.metabolite:hxa
biggM:hxa
Hexanoate (n-C6:0)
sabiork.compound:2297
sabiorkM:2297
Hexanoate
Caproate
Hexanoic acid
Hexylic acid
n-Caproic acid
seed.compound:cpd01113
seedM:cpd01113
Hexanoate
Hexanoate (n-C6:0)
Hexanoic acid
Hexylic acid
a hexonic acid
caproate
hexanoate
hexanoic acid
hxa
n-Caproic acid
kegg.compound:C01585
keggC:C01585
Hexanoic acid
Hexanoate
Hexylic acid
n-Caproic acid
envipath:...76774b301631
envipathM:...76774b301631
compound 44296
SLM:000001196
slm:000001196
hexanoate
Caproate
metacyc.compound:HEXANOATE
metacycM:HEXANOATE
hexanoate
a hexonic acid
caproate
caproic acid
hexanoate (n-C6:0)
hexanoic acid
CHEBI:30776
chebi:30776
hexanoic acid
1-hexanoic acid
1-pentanecarboxylic acid
6:0
C6:0
CH3-[CH2]4-COOH
HEXANOIC ACID
Hexanoate
Hexanoic acid
Hexylic acid
Pentanecarboxylic acid
butylacetic acid
caproic acid
capronic acid
hexoic acid
n-Caproic acid
n-hexanoic acid
n-hexoic acid
n-hexylic acid
pentiformic acid
pentylformic acid
hmdb:HMDB00535
hmdb:HMDB0061883
hmdb:HMDB61883
chebi:14398
chebi:24569
chebi:24571
chebi:40213
chebi:5702
biggM:M_caproic
biggM:M_hxa
keggC:M_C01585
seedM:M_cpd01113
secondary/obsolete/fantasy identifier