Feedback

hexanoate

Properties
MNX_IDMNXM1653
formulaC6H11O2
charge-1
mass115.15034
referencechebi:17120
Image of MNXM1653
InChIKeyFUZZWVXGSFPDMH-UHFFFAOYSA-M
InChIInChI=1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8)/p-1
SMILESCCCCCC([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref27
Distinct compatimentalized reactions in models16

Similar chemical compounds in external resources
IdentifierDescription
keggC:C01585 Hexanoic acid
Hexanoate
Hexylic acid
n-Caproic acid
metacycM:HEXANOATE hexanoate
Hexanoate (n-C6:0)
a hexonic acid
caproate
hexanoic acid
chebi:17120
reactome:R-ALL-444194
hexanoate
1-hexanoate
1-pentacarboxylate
1-pentanecarboxylate
CH3-[CH2]4-COO(-)
butylacetate
caproate
capronate
hexoate
hexylate
n-caproate
n-hexanoate
n-hexoate
n-hexylate
nPnCO2 anion
pentanecarboxylate
pentylformate
hmdb:HMDB0000535 Caproic acid
1-Hexanoate
1-Hexanoic acid
1-Pentanecarboxylate
1-Pentanecarboxylic acid
6:0
Bi(ohex)3
Bismuth(III)hexanoate
Butylacetate
Butylacetic acid
C6:0
CH3-[CH2]4-COOH
Caproate
Capronate
Capronic acid
FA(6:0)
Hexanoate
Hexanoic acid
Hexanoic acid, barium salt
Hexanoic acid, calcium salt
Hexanoic acid, copper (2+) salt
Hexanoic acid, manganese (2+) salt
Hexanoic acid, nickel (2+) salt
Hexanoic acid, potassium salt
Hexanoic acid, rhodium (2+) salt
Hexanoic acid, sodium salt
Hexanoic acid, sodium salt, 1-(11)C-labeled
Hexoate
Hexoic acid
Hexylate
Hexylic acid
N-Caproate
N-Caproic acid
N-Hexanoate
N-Hexanoic acid
N-Hexoate
N-Hexoic acid
N-Hexylate
N-Hexylic acid
Pentanecarboxylate
Pentanecarboxylic acid
Pentiformate
Pentiformic acid
Pentylformate
Pentylformic acid
hexanoic acid
seedM:cpd01113 Hexanoate
Hexanoate (n-C6:0)
Hexanoic acid
Hexylic acid
a hexonic acid
caproate
hexanoate
hexanoic acid
hxa
n-Caproic acid
sabiorkM:2297 Hexanoate
Caproate
Hexanoic acid
Hexylic acid
n-Caproic acid
slm:000001196 hexanoate
Caproate
lipidmaps:LMFA01010006 Caproic acid
Butylacetic acid
C6:0
Capronic acid
FA(6:0)
Hexanoic acid
Pentylformic acid
hmdb:HMDB0061883 Caproate (6:0)
1-Hexanoate
1-Hexanoic acid
1-Pentanecarboxylate
1-Pentanecarboxylic acid
6:0
Bi(ohex)3
Bismuth(III)hexanoate
Butylacetate
Butylacetic acid
C6:0
CH3-[CH2]4-COOH
Caproate
Capronate
Capronic acid
FA(6:0)
Hexanoate
Hexanoic acid
Hexanoic acid, barium salt
Hexanoic acid, calcium salt
Hexanoic acid, copper (2+) salt
Hexanoic acid, manganese (2+) salt
Hexanoic acid, nickel (2+) salt
Hexanoic acid, potassium salt
Hexanoic acid, rhodium (2+) salt
Hexanoic acid, sodium salt
Hexanoic acid, sodium salt, 1-(11)C-labeled
Hexoate
Hexoic acid
Hexylate
Hexylic acid
N-Caproate
N-Caproic acid
N-Hexanoate
N-Hexanoic acid
N-Hexoate
N-Hexoic acid
N-Hexylate
N-Hexylic acid
Pentanecarboxylate
Pentanecarboxylic acid
Pentiformate
Pentiformic acid
Pentylformate
Pentylformic acid
hexanoic acid
biggM:M_caproic
biggM:M_hxa
chebi:14398
chebi:24569
chebi:24571
chebi:40213
chebi:5702
hmdb:HMDB00535
hmdb:HMDB61883
keggC:M_C01585
seedM:M_cpd01113
secondary/obsolete/fantasy identifier
chebi:30776 hexanoic acid
1-hexanoic acid
1-pentanecarboxylic acid
6:0
C6:0
CH3-[CH2]4-COOH
HEXANOIC ACID
Hexanoate
Hexanoic acid
Hexylic acid
Pentanecarboxylic acid
butylacetic acid
caproic acid
capronic acid
hexoic acid
n-Caproic acid
n-hexanoic acid
n-hexoic acid
n-hexylic acid
pentiformic acid
pentylformic acid
biggM:hxa Hexanoate (n-C6:0)
envipath:...76774b301631 compound 44296
biggM:caproic Caproic Acid
MNXM724369is deprecated and replaced by this entry