Feedback

 

D-fructuronate

Image of MNXM1660
Properties
MNX_IDMNXM1660
formulaC6H9O7
charge-1
mass193.132
referencechebi:59863
InChIKeyPTCIWUZVDIQTOW-XDJBDKDSSA-M
InChIInChI=1S/C6H10O7/c7-1-6(12)4(9)2(8)3(13-6)5(10)11/h2-4,7-9,12H,1H2,(H,10,11)/p-1/t2-,3+,4+,6?/m1/s1
SMILESOCC1(O)O[C@@H]([C@@H](O)[C@@H]1O)C([O-])=O

This chemical compound does not exist in my selection



Occurrences of D-fructuronate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:fruur D-Fructuronate
chebi:12927
chebi:16849
chebi:20936
D-fructuronate
chebi:20937 D-fructuronic acid
D-lyxo-hex-5-ulosonic acid
chebi:4126 D-Fructuronate
D-Fructuronic acid
D-fructofuranuronic acid
D-lyxo-hex-5-ulofuranosonic acid
PTCIWUZVDIQTOW-XDJBDKDSSA-N
chebi:59863 D-fructofuranuronate
D-fructuronate
D-lyxo-hex-5-ulofuranosonate
PTCIWUZVDIQTOW-XDJBDKDSSA-M
kegg:C00905 D-Fructuronate
D-Fructuronic acid
metacyc:FRUCTURONATE D-fructuronate
FRUCTURONATE
fructuronate
seed:cpd00672 D-Fructuronate
D-Fructuronic acid
fruur
deprecated:MNXM48440
deprecated:MNXM90621