Feedback

(2-aminoethyl)phosphonate

Properties
MNX_IDMNXM1692
formulaC2H8NO3P
charge0
mass125.063621
referencechebi:57418
Image of MNXM1692
InChIKeyQQVDJLLNRSOCEL-UHFFFAOYSA-N
InChIInChI=1S/C2H8NO3P/c3-1-2-7(4,5)6/h1-3H2,(H2,4,5,6)
SMILES[NH3+]CCP(O)([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref16
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
hmdb:HMDB0011747 Ciliatine
(2-Aminoethane)phosphonate
(2-Aminoethane)phosphonic acid
(2-Aminoethyl)phosphonate
(2-Aminoethyl)phosphonic acid
(2-aminoethyl)phosphonic acid
2 Aminoethylphosphonic acid
2-Aminoethylphosphonate
2-Aminoethylphosphonic acid
Acid, 2-aminoethylphosphonic
Acid, aminoethylphosphonic
Aminoethylphosphonate
Aminoethylphosphonic acid
Phosphonoethylamine
b-Aminoethylphosphonate
b-Aminoethylphosphonic acid
beta-Aminoethylphosphonate
beta-Aminoethylphosphonic acid
beta-aminoethylphosphonate
beta-aminoethylphosphonic acid
ciliatine
keggC:C03557 2-Aminoethylphosphonate
(2-Aminoethyl)phosphonate
Ciliatine
chebi:15573 (2-aminoethyl)phosphonic acid
(2-Aminoethane)phosphonic acid
(2-Aminoethyl)phosphonate
2-Aminoethylphosphonate
2-aminoethylphosphonate
Aminoethylphosphonic acid
Ciliatine
Phosphonoethylamine
beta-Aminoethylphosphonic acid
biggM:2ameph 2-Aminoethylphosphonate
biggM:M_2ameph
chebi:10849
chebi:172
chebi:19469
chebi:19470
hmdb:HMDB11747
keggC:M_C03557
seedM:M_cpd02233
secondary/obsolete/fantasy identifier
chebi:57418 (2-aminoethyl)phosphonate
(2-aminoethyl)phosphonic acid zwitterion
hydrogen (2-azaniumylethyl)phosphonate
metacycM:CPD-1106 (2-aminoethyl)phosphonate
(2-aminoethane)phosphonate
2-AEPn
2-aminoethylphosphonate
2-aminoethylphosphonic acid
ciliatine
phosphonoethylamine
seedM:cpd02233 Ciliatine
(2-Aminoethyl)phosphonate
(2-aminoethane)phosphonate
(2-aminoethyl)phosphonate
2-AEPn
2-Aminoethylphosphonate
2-aminoethanephosphonate
2-aminoethylphosphonate
2-aminoethylphosphonic acid
2aeppn
ciliatine
phosphonoethylamine
MNXM90503is deprecated and replaced by this entry