Feedback

(2-aminoethyl)phosphonate

PropertiesImageOccurences in reactions
MNX_IDMNXM1692Image of MNXM1692
#reac
in my sandbox 0
in MNXref (generic)17
in models (compartimentalized) 9
formulaC2H8NO3P
charge0
mass125.063621
referencechebi:57418
InChIKeyQQVDJLLNRSOCEL-UHFFFAOYSA-N
InChIInChI=1S/C2H8NO3P/c3-1-2-7(4,5)6/h1-3H2,(H2,4,5,6)
SMILES[NH3+]CCP(O)([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57418
chebi:57418
(2-aminoethyl)phosphonate
(2-aminoethyl)phosphonic acid zwitterion
hydrogen (2-azaniumylethyl)phosphonate
metacyc.compound:CPD-1106
metacycM:CPD-1106
(2-aminoethyl)phosphonate
(2-aminoethane)phosphonate
2-AEPn
2-aminoethylphosphonate
2-aminoethylphosphonic acid
ciliatine
phosphonoethylamine
CHEBI:15573
chebi:15573
(2-aminoethyl)phosphonic acid
(2-Aminoethane)phosphonic acid
(2-Aminoethyl)phosphonate
2-Aminoethylphosphonate
2-aminoethylphosphonate
Aminoethylphosphonic acid
Ciliatine
Phosphonoethylamine
beta-Aminoethylphosphonic acid
bigg.metabolite:2ameph
biggM:2ameph
2-Aminoethylphosphonate
kegg.compound:C03557
keggC:C03557
2-Aminoethylphosphonate
(2-Aminoethyl)phosphonate
Ciliatine
hmdb:HMDB0011747 Ciliatine
(2-Aminoethane)phosphonate
(2-Aminoethane)phosphonic acid
(2-Aminoethyl)phosphonate
(2-Aminoethyl)phosphonic acid
(2-aminoethyl)phosphonic acid
2 Aminoethylphosphonic acid
2-Aminoethylphosphonate
2-Aminoethylphosphonic acid
Acid, 2-aminoethylphosphonic
Acid, aminoethylphosphonic
Aminoethylphosphonate
Aminoethylphosphonic acid
Phosphonoethylamine
b-Aminoethylphosphonate
b-Aminoethylphosphonic acid
beta-Aminoethylphosphonate
beta-Aminoethylphosphonic acid
beta-aminoethylphosphonate
beta-aminoethylphosphonic acid
ciliatine
seed.compound:cpd02233
seedM:cpd02233
Ciliatine
(2-Aminoethyl)phosphonate
(2-aminoethane)phosphonate
(2-aminoethyl)phosphonate
2-AEPn
2-Aminoethylphosphonate
2-aminoethanephosphonate
2-aminoethylphosphonate
2-aminoethylphosphonic acid
2aeppn
ciliatine
phosphonoethylamine
hmdb:HMDB11747
chebi:10849
chebi:172
chebi:19469
chebi:19470
biggM:M_2ameph
keggC:M_C03557
seedM:M_cpd02233
secondary/obsolete/fantasy identifier