Feedback

(R)-mandelate

Properties
MNX_IDMNXM1698
formulaC8H7O3
charge-1
mass151.13938
referencechebi:32382
Image of MNXM1698
InChIKeyIWYDHOAUDWTVEP-SSDOTTSWSA-M
InChIInChI=1S/C8H8O3/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7,9H,(H,10,11)/p-1/t7-/m1/s1
SMILESO[C@@H](C([O-])=O)c1ccccc1

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
envipath:...af2ef5bf844e (R)-Mandelate
seedM:cpd01357 (R)-Mandelate
(R)-2-Hydroxy-2-phenylacetate
(R)-2-Hydroxy-2-phenylacetic acid
(R)-2-hydroxy-2-phenylacetate
(R)-2-hydroxy-2-phenylacetic acid
(R)-Mandelic acid
(R)-mandelate
(R)-mandelic acid
D(-)-mandelate
D-mandelate
chebi:32382 (R)-mandelate
(2R)-hydroxy(phenyl)acetate
(R)-2-Hydroxy-2-phenylacetate
(R)-Mandelate
chebi:17656 (R)-mandelic acid
(-)-(R)-mandelic acid
(-)-alpha-hydroxyphenylacetic acid
(-)-mandelic acid
(2R)-2-hydroxy-2-phenylacetic acid
(2R)-hydroxy(phenyl)acetic acid
(R)-2-Hydroxy-2-phenylacetic acid
(R)-MANDELIC ACID
(R)-Mandelic acid
(R)-Mandelsaeure
(R)-alpha-hydroxybenzeneacetic acid
(R)-alpha-hydroxyphenylacetic acid
D(-)-mandelic acid
D-2-phenylglycolic acid
D-mandelic acid
metacycM:CPD-121 (R)-mandelate
(R)-2-hydroxy-2-phenylacetate
(R)-2-hydroxy-2-phenylacetic acid
(R)-mandelic acid
D(-)-mandelate
D-mandelate
keggC:C01983
sabiorkM:2347
(R)-Mandelate
(R)-2-Hydroxy-2-phenylacetate
(R)-2-Hydroxy-2-phenylacetic acid
(R)-Mandelic acid
chebi:11004
chebi:18688
chebi:18689
chebi:344
chebi:45338
hmdb:HMDB62635
keggC:M_C01983
seedM:M_cpd01357
secondary/obsolete/fantasy identifier
hmdb:HMDB0062635 (R)-mandelic Acid
(-)-(R)-Mandelate
(-)-(R)-Mandelic acid
(-)-Mandelate
(-)-Mandelic acid
(-)-a-Hydroxyphenylacetate
(-)-a-Hydroxyphenylacetic acid
(-)-alpha-Hydroxyphenylacetate
(-)-alpha-Hydroxyphenylacetic acid
(-)-alpha-hydroxyphenylacetate
(-)-alpha-hydroxyphenylacetic acid
(2R)-2-Hydroxy-2-phenylacetate
(2R)-2-Hydroxy-2-phenylacetic acid
(2R)-2-hydroxy-2-phenylacetic acid
(R)-2-Hydroxy-2-phenylacetate
(R)-2-Hydroxy-2-phenylacetic acid
(R)-Mandelate
(R)-Mandelsaeure
(R)-a-Hydroxybenzeneacetate
(R)-a-Hydroxybenzeneacetic acid
(R)-a-Hydroxyphenylacetate
(R)-a-Hydroxyphenylacetic acid
(R)-alpha-Hydroxybenzeneacetate
(R)-alpha-Hydroxybenzeneacetic acid
(R)-alpha-Hydroxyphenylacetate
(R)-alpha-Hydroxyphenylacetic acid
(R)-alpha-hydroxybenzeneacetate
(R)-alpha-hydroxybenzeneacetic acid
(R)-alpha-hydroxyphenylacetate
(R)-alpha-hydroxyphenylacetic acid
D(-)-Mandelate
D(-)-Mandelic acid
D-2-Phenylglycolate
D-2-Phenylglycolic acid
D-Mandelate
D-Mandelic acid
mandelic acid, (+-)-