Feedback

2-(1-hydroxyethyl)thiamine diphosphate

PropertiesImageOccurences in reactions
MNX_IDMNXM1705Image of MNXM1705
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 7
formulaC14H21N4O8P2S
charge-1
mass467.352222
referencechebi:58939
InChIKeyRRUVJGASJONMDY-UHFFFAOYSA-M
InChIInChI=1S/C14H22N4O8P2S/c1-8-12(4-5-25-28(23,24)26-27(20,21)22)29-14(9(2)19)18(8)7-11-6-16-10(3)17-13(11)15/h6,9,19H,4-5,7H2,1-3H3,(H4-,15,16,17,20,21,22,23,24)/p-1
SMILESCC(O)c1sc(CCOP([O-])(=O)OP(O)([O-])=O)c(C)[n+]1Cc1cnc(C)nc1N
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58939
chebi:58939
2-(1-hydroxyethyl)thiamine diphosphate
2-(1-hydroxyethyl)thiamine diphosphate dianion
2-(1-hydroxyethyl)thiamine diphosphate(2-)
2-(1-hydroxyethyl)thiamine(1+) diphosphate(3-)
3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(1-hydroxyethyl)-5-(2-diphosphonatoethyl)-4-methyl-1,3-thiazol-3-ium
CHEBI:978
chebi:978
2-(1-hydroxyethyl)thiamine diphosphate
2-(alpha-Hydroxyethyl)thiamine diphosphate
2-Hydroxyethyl-ThPP
3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-2-(1-hydroxyethyl)-5-(2-diphosphoethyl)-4-methyl-1,3-thiazol-3-ium
hmdb:HMDB0003904 2-(a-Hydroxyethyl)thiamine diphosphate
2-(a-Hydroxyethyl)thiamine diphosphoric acid
2-(alpha-Hydroxyethyl)thiamine diphosphate
2-(alpha-Hydroxyethyl)thiamine diphosphoric acid
2-(alpha-hydroxyethyl)thiamine diphosphate
2-(alpha-hydroxyethyl)thiamine diphosphoric acid
2-Hydroxyethyl-THPP
2-Hydroxyethyl-ThPP
3-[(4-amino-2-Methyl-5-pyrimidinyl)methyl]-2-(1-hydroxyethyl)-4-methyl-5-(4,6,6-trihydroxy-3,5-dioxa-4,6-diphosphahex-1-yl)- P,p'-dioxide
3-[(4-amino-2-Methyl-5-pyrimidinyl)methyl]-2-(1-hydroxyethyl)-5-(2-hydroxyethyl)-4-methyl- 5-(trihydrogen pyrophosphate) (8ci)
3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-5-(2-{[hydroxy(phosphonooxy)phosphoryl]oxy}ethyl)-2-(1-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium
Thiazolium
bigg.metabolite:2ahethmpp
biggM:2ahethmpp
2-(alpha-Hydroxyethyl)thiamine diphosphate
sabiork.compound:1839
sabiorkM:1839
kegg.compound:C05125
keggC:C05125
2-(alpha-Hydroxyethyl)thiamine diphosphate
2-Hydroxyethyl-ThPP
metacyc.compound:2-ALPHA-HYDROXYETHYL-THPP
metacycM:2-ALPHA-HYDROXYETHYL-THPP
2-(alpha-hydroxyethyl)thiamine diphosphate
2-(alpha-hydroxyethyl)-TPP
2-(alpha-hydroxyethyl)-ThPP
seed.compound:cpd03049
seedM:cpd03049
2-Hydroxyethyl-ThPP
2-(alpha-Hydroxyethyl)thiamine diphosphate
2-(alpha-hydroxyethyl)-TPP
2-(alpha-hydroxyethyl)-ThPP
2-(alpha-hydroxyethyl)thiamine diphosphate
hmdb:HMDB03904
biggM:M_2ahethmpp
keggC:M_C05125
seedM:M_cpd03049
secondary/obsolete/fantasy identifier