Feedback

2-isopropylmaleate

PropertiesImageOccurences in reactions
MNX_IDMNXM1706Image of MNXM1706
#reac
in my sandbox 0
in MNXref (generic)3
in models (compartimentalized) 2
formulaC7H8O4
charge-2
mass156.13602
referencechebi:58085
InChIKeyNJMGRJLQRLFQQX-HYXAFXHYSA-L
InChIInChI=1S/C7H10O4/c1-4(2)5(7(10)11)3-6(8)9/h3-4H,1-2H3,(H,8,9)(H,10,11)/p-2/b5-3-
SMILESCC(C)C(=C\C([O-])=O)\C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58085
chebi:58085
2-isopropylmaleate
(2L)-2-isopropylbut-2-enedioate
(2Z)-2-(propan-2-yl)but-2-enedioate
2-isopropylmaleate dianion
2-isopropylmaleate(2-)
bigg.metabolite:2ippm
biggM:2ippm
2-Isopropylmaleate
seed.compound:cpd01710
seedM:cpd01710
2-Isopropylmaleate
2-isopropylmaleate
2-isopropylmaleic acid
2ippm
beta-Isopropylmaleate
beta-isopropylmaleate
sabiork.compound:2472
sabiorkM:2472
2-Isopropylmaleate
Isopropylmaleate
beta-Isopropylmaleate
beta-isopropylmaleate
kegg.compound:C02631
keggC:C02631
2-Isopropylmaleate
beta-Isopropylmaleate
metacyc.compound:CPD-9451
metacycM:CPD-9451
2-isopropylmaleate
2-isopropylmaleic acid
beta-isopropylmaleate
CHEBI:17275
chebi:17275
2-isopropylmaleic acid
(2Z)-2-(propan-2-yl)but-2-enedioic acid
2-Isopropylmaleate
beta-Isopropylmaleate
hmdb:HMDB0012241 Isopropylmaleate
(2Z)-2-(propan-2-yl)but-2-enedioic acid
2-Isopropylmaleate
2-Isopropylmaleic acid
2-isopropylmaleic acid
Isopropylmaleic acid
b-Isopropylmaleate
b-Isopropylmaleic acid
beta-Isopropylmaleate
beta-Isopropylmaleic acid
beta-isopropylmaleate
beta-isopropylmaleic acid
hmdb:HMDB12241
chebi:11604
chebi:1179
chebi:19668
biggM:M_2ippm
keggC:M_C02631
seedM:M_cpd01710
secondary/obsolete/fantasy identifier