Feedback

3-deoxy-D-glycero-2,5-hexodiulosonate

PropertiesImageOccurences in reactions
MNX_IDMNXM1709Image of MNXM1709
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 2
formulaC6H7O6
charge-1
mass175.11618
referencechebi:29071
InChIKeyIBGYNIRCYXIAON-VKHMYHEASA-M
InChIInChI=1S/C6H8O6/c7-2-5(10)3(8)1-4(9)6(11)12/h3,7-8H,1-2H2,(H,11,12)/p-1/t3-/m0/s1
SMILESOCC(=O)[C@@H](O)CC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:29071
chebi:29071
3-deoxy-D-glycero-2,5-hexodiulosonate
(4S)-4,6-dihydroxy-2,5-dioxohexanoate
3-deoxy-D-glycero-hexo-2,5-diulosonate
kegg.compound:C04349
keggC:C04349
(4S)-4,6-Dihydroxy-2,5-dioxohexanoate
2,5-Diketo-3-deoxy-D-gluconate
3-Deoxy-D-glycero-2,5-hexodiulosonate
seed.compound:cpd02663
seedM:cpd02663
2,5-Diketo-3-deoxy-D-gluconate
(4S)-4,6-Dihydroxy-2,5-dioxohexanoate
(4S)-4,6-dihydroxy-2,5-dioxohexanoate
2,5-didehydro-3-deoxy-L-galactonate
2,5-diketo-3-deoxy-D-gluconate
2,5-diketo-3-deoxygluconate
3-Deoxy-D-glycero-2,5-hexodiulosonate
3-deoxy-D-glycero-2,5-hexodiulosonate
46dh25dohxn
DKII
metacyc.compound:CPD-343
metacycM:CPD-343
3-deoxy-D-glycero-2,5-hexodiulosonate
(4S)-4,6-dihydroxy-2,5-dioxohexanoate
2,5-didehydro-3-deoxy-L-galactonate
2,5-diketo-3-deoxy-D-gluconate
2,5-diketo-3-deoxygluconate
DKII
CHEBI:15623
chebi:15623
3-deoxy-D-glycero-hexo-2,5-diulosonic acid
(4S)-4,6-Dihydroxy-2,5-dioxohexanoate
(4S)-4,6-dihydroxy-2,5-dioxohexanoic acid
2,5-Diketo-3-deoxy-D-gluconate
3-Deoxy-D-glycero-2,5-hexodiulosonate
lipidmaps:LMFA01050490
lipidmapsM:LMFA01050490
3-deoxy-D-glycero-hexo-2,5-diulosonic acid
(4S)-4,6-dihydroxy-2,5-dioxohexanoic acid
3-deoxy-D-glycero-2,5-hexodiulosonic acid
3-deoxy-D-glycero-hexo-2,5-diulosonic acid
bigg.metabolite:46dh25dohxn
biggM:46dh25dohxn
4S 4 6 Dihydroxy 2 5 dioxohexanoate
chebi:10901
chebi:11790
chebi:18579
chebi:20004
chebi:229
biggM:M_46dh25dohxn
keggC:M_C04349
seedM:M_cpd02663
secondary/obsolete/fantasy identifier