Feedback

5-amino-2-oxopentanoate

PropertiesImageOccurences in reactions
MNX_IDMNXM1714Image of MNXM1714
#reac
in my sandbox 0
in MNXref (generic)11
in models (compartimentalized) 6
formulaC5H9NO3
charge0
mass131.1299
referencechebi:58802
InChIKeyBWHGMFYTDQEALD-UHFFFAOYSA-N
InChIInChI=1S/C5H9NO3/c6-3-1-2-4(7)5(8)9/h1-3,6H2,(H,8,9)
SMILES[NH3+]CCCC(=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58802
chebi:58802
5-amino-2-oxopentanoate
5-amino-2-oxopentanoic acid zwitterion
5-ammonio-2-oxopentanoate
5-azaniumyl-2-oxopentanoate
seed.compound:cpd00815
seedM:cpd00815
2-Oxo-5-aminovalerate
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-keto-5-aminovalerate
2-keto-ornithine
2-oxo-5-aminovalerate
5-Amino-2-oxopentanoate
5-Amino-2-oxopentanoic acid
5-amino-2-oxo-pentanoate
5-amino-2-oxo-pentanoic acid
5-amino-2-oxopentanoate
5-amino-2-oxopentanoic acid
alpha-Keto-delta-aminopentanoate
alpha-keto-delta-aminovalerate
alpha-keto-delta-aminovaleric acid
lipidmaps:LMFA01060169
lipidmapsM:LMFA01060169
2-oxo-5-amino-pentanoic acid
2-oxo-5-amino-pentanoic acid
5-Amino-2-oxopentanoic acid
bigg.metabolite:5a2opntn
biggM:5a2opntn
5-Amino-2-oxopentanoate
sabiork.compound:2247
sabiorkM:2247
5-Amino-2-oxopentanoate
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
5-Amino-2-oxopentanoic acid
alpha-Keto-delta-aminopentanoate
kegg.compound:C01110
keggC:C01110
5-Amino-2-oxopentanoic acid
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
5-Amino-2-oxopentanoate
alpha-Keto-delta-aminopentanoate
hmdb:HMDB0006272 5-Amino-2-oxopentanoic acid
2-oxo-5-Aminopentanoate
2-oxo-5-Aminopentanoic acid
2-oxo-5-Aminovalerate
2-oxo-5-Aminovaleric acid
2-oxo-5-amino-Pentanoate
2-oxo-5-amino-Pentanoic acid
5-amino-2-Oxopentanoate
5-amino-2-Oxovalerate
5-amino-2-Oxovaleric acid
5-amino-2-oxopentanoic acid
a-keto-delta-Aminopentanoate
a-keto-delta-Aminopentanoic acid
a-keto-delta-aminopentanoate
a-keto-delta-aminopentanoic acid
alpha-keto-delta-Aminopentanoate
alpha-keto-delta-Aminopentanoic acid
alpha-keto-delta-aminopentanoate
alpha-keto-delta-aminopentanoic acid
CHEBI:17572
chebi:17572
5-amino-2-oxopentanoate
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
2-oxo-5-amino-pentanoate
2-oxo-5-aminopentanoate
5-Amino-2-oxopentanoate
5-Amino-2-oxopentanoic acid
alpha-Keto-delta-aminopentanoate
alpha-keto-delta-aminopentanoate
metacyc.compound:5-AMINO-2-OXOPENTANOATE
metacycM:5-AMINO-2-OXOPENTANOATE
5-amino-2-oxopentanoate
2-keto-5-aminovalerate
2-keto-ornithine
2-oxo-5-aminovalerate
5-amino-2-oxopentanoic acid
alpha-keto-delta-aminovalerate
alpha-keto-delta-aminovaleric acid
CHEBI:49268
chebi:49268
5-amino-2-oxopentanoic acid
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
5-Amino-2-oxopentanoate
5-amino-2-oxovaleric acid
alpha-Keto-delta-aminopentanoate
hmdb:HMDB06272
chebi:12104
chebi:2026
chebi:20540
biggM:M_5a2opntn
keggC:M_C01110
seedM:M_cpd00815
secondary/obsolete/fantasy identifier