Feedback

5-amino-2-oxopentanoate

Properties
MNX_IDMNXM1714
formulaC5H9NO3
charge0
mass131.1299
referencechebi:58802
Image of MNXM1714
InChIKeyBWHGMFYTDQEALD-UHFFFAOYSA-N
InChIInChI=1S/C5H9NO3/c6-3-1-2-4(7)5(8)9/h1-3,6H2,(H,8,9)
SMILES[NH3+]CCCC(=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref11
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
seedM:cpd00815 2-Oxo-5-aminovalerate
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-keto-5-aminovalerate
2-keto-ornithine
2-oxo-5-aminovalerate
5-Amino-2-oxopentanoate
5-Amino-2-oxopentanoic acid
5-amino-2-oxo-pentanoate
5-amino-2-oxo-pentanoic acid
5-amino-2-oxopentanoate
5-amino-2-oxopentanoic acid
alpha-Keto-delta-aminopentanoate
alpha-keto-delta-aminovalerate
alpha-keto-delta-aminovaleric acid
chebi:49268 5-amino-2-oxopentanoic acid
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
5-Amino-2-oxopentanoate
5-amino-2-oxovaleric acid
alpha-Keto-delta-aminopentanoate
biggM:5a2opntn 5-Amino-2-oxopentanoate
keggC:C01110 5-Amino-2-oxopentanoic acid
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
5-Amino-2-oxopentanoate
alpha-Keto-delta-aminopentanoate
biggM:M_5a2opntn
chebi:12104
chebi:2026
chebi:20540
hmdb:HMDB06272
keggC:M_C01110
seedM:M_cpd00815
secondary/obsolete/fantasy identifier
chebi:17572 5-amino-2-oxopentanoate
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
2-oxo-5-amino-pentanoate
2-oxo-5-aminopentanoate
5-Amino-2-oxopentanoate
5-Amino-2-oxopentanoic acid
alpha-Keto-delta-aminopentanoate
alpha-keto-delta-aminopentanoate
chebi:58802 5-amino-2-oxopentanoate
5-amino-2-oxopentanoic acid zwitterion
5-ammonio-2-oxopentanoate
5-azaniumyl-2-oxopentanoate
hmdb:HMDB0006272 5-Amino-2-oxopentanoic acid
2-oxo-5-Aminopentanoate
2-oxo-5-Aminopentanoic acid
2-oxo-5-Aminovalerate
2-oxo-5-Aminovaleric acid
2-oxo-5-amino-Pentanoate
2-oxo-5-amino-Pentanoic acid
5-amino-2-Oxopentanoate
5-amino-2-Oxovalerate
5-amino-2-Oxovaleric acid
5-amino-2-oxopentanoic acid
a-keto-delta-Aminopentanoate
a-keto-delta-Aminopentanoic acid
a-keto-delta-aminopentanoate
a-keto-delta-aminopentanoic acid
alpha-keto-delta-Aminopentanoate
alpha-keto-delta-Aminopentanoic acid
alpha-keto-delta-aminopentanoate
alpha-keto-delta-aminopentanoic acid
lipidmaps:LMFA01060169 2-oxo-5-amino-pentanoic acid
2-oxo-5-amino-pentanoic acid
5-Amino-2-oxopentanoic acid
metacycM:5-AMINO-2-OXOPENTANOATE 5-amino-2-oxopentanoate
2-keto-5-aminovalerate
2-keto-ornithine
2-oxo-5-aminovalerate
5-amino-2-oxopentanoic acid
alpha-keto-delta-aminovalerate
alpha-keto-delta-aminovaleric acid
sabiorkM:2247 5-Amino-2-oxopentanoate
2-Oxo-5-amino-pentanoate
2-Oxo-5-aminopentanoate
2-Oxo-5-aminovalerate
5-Amino-2-oxopentanoic acid
alpha-Keto-delta-aminopentanoate