Feedback

succinate semialdehyde

PropertiesImageOccurences in reactions
MNX_IDMNXM172Image of MNXM172
#reac
in my sandbox 0
in MNXref (generic)41
in models (compartimentalized) 29
formulaC4H5O3
charge-1
mass101.0807
referencechebi:57706
InChIKeyUIUJIQZEACWQSV-UHFFFAOYSA-M
InChIInChI=1S/C4H6O3/c5-3-1-2-4(6)7/h3H,1-2H2,(H,6,7)/p-1
SMILES[O-]C(=O)CCC=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
reactome:R-ALL-880046
reactomeM:R-ALL-880046
CHEBI:57706
chebi:57706
succinate semialdehyde
4-oxobutanoate
seed.compound:cpd00199
seedM:cpd00199
4-Oxobutanoate
Succinate semialdehyde
Succinic semialdehyde
succ-S-ald
succinate semialdehyde
succinic semialdehyde
succinyl semialdehyde
sucsal
sabiork.compound:1984
sabiorkM:1984
kegg.compound:C00232
keggC:C00232
Succinate semialdehyde
4-Oxobutanoate
Succinic semialdehyde
hmdb:HMDB0001259 Succinic acid semialdehyde
2-Formylpropionic acid ethyl ester
3-Formylpropanoate
3-Formylpropanoic acid
3-Formylpropionate
3-Formylpropionic acid
4-Oxobutanoate
4-Oxobutanoic acid
4-oxobutanoic acid
Butryaldehydate
Butryaldehydic acid
Semialdehyde succinique
Succinaldehydate
Succinaldehydic acid
Succinate semialdehyde
Succinic semialdehyde
Succinic semialdehyde, calcium salt
b-Formylpropionate
b-Formylpropionic acid
beta-Formylpropionate
beta-Formylpropionic acid
beta-formylpropionate
beta-formylpropionic acid
gamma-Oxybutyrate
gamma-Oxybutyric acid
succinic semialdehyde
lipidmaps:LMFA06000118
lipidmapsM:LMFA06000118
Succinic acid semialdehyde
4-oxo-butanoic acid
FA(4:0(Ke))
bigg.metabolite:sucsal
biggM:sucsal
envipath:...40412ae31e43
envipathM:...40412ae31e43
Succinic semialdehyde
envipath:...c86bf0d44409
envipathM:...c86bf0d44409
compound 1579
CHEBI:26805
chebi:26805
succinate semialdehyde
metacyc.compound:SUCC-S-ALD
metacycM:SUCC-S-ALD
succinate semialdehyde
succ-S-ald
succinic semialdehyde
succinyl semialdehyde
CHEBI:16265
chebi:16265
succinic semialdehyde
3-formylpropanoic acid
3-formylpropionic acid
4-Oxobutanoate
4-oxobutanoic acid
Succinate semialdehyde
Succinic semialdehyde
beta-formylpropionic acid
semialdehyde succinique
succinaldehydic acid
succinic acid semialdehyde
hmdb:HMDB01259
chebi:15126
chebi:26804
chebi:9305
biggM:M_sucsal
keggC:M_C00232
seedM:M_cpd00199
secondary/obsolete/fantasy identifier