Feedback

D-galactonate

PropertiesImageOccurences in reactions
MNX_IDMNXM1734Image of MNXM1734
#reac
in my sandbox 0
in MNXref (generic)12
in models (compartimentalized) 5
formulaC6H11O7
charge-1
mass195.14734
referencechebi:12931
InChIKeyRGHNJXZEOKUKBD-MGCNEYSASA-M
InChIInChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/p-1/t2-,3+,4+,5-/m1/s1
SMILESOC[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:12931
chebi:12931
D-galactonate
D-Galactonate
bigg.metabolite:galctn__D
biggM:galctn__D
D-Galactonate
sabiork.compound:2177
sabiorkM:2177
kegg.compound:C00880
keggC:C00880
D-Galactonate
D-Galactonic acid
seed.compound:cpd00653
seedM:cpd00653
D-Galactonate
D-Galactonic acid
D-galactonate
galctn-D
metacyc.compound:D-GALACTONATE
metacycM:D-GALACTONATE
D-galactonate
galactonate
CHEBI:16534
chebi:16534
D-galactonic acid
D-Galactonic acid
hmdb:HMDB0000565 Galactonic acid
(2R,3S,4S,5R)-2,3,4,5,6-pentahydroxyhexanoic acid
D-Galactonate
D-Galactonic acid
Galactonate
Galactonic acid, (D)-isomer
Galactonic acid, (L)-isomer
Galactonic acid, monopotassium salt
galactonic acid
CHEBI:24148
chebi:24148
galactonate
CHEBI:24149
chebi:24149
galactonic acid
hmdb:HMDB00565
chebi:4132
biggM:M_galctn__D
keggC:M_C00880
seedM:M_cpd00653
secondary/obsolete/fantasy identifier