Feedback

deoxyamidinoproclavaminate

Properties
MNX_IDMNXM1738
formulaC9H16N4O3
charge0
mass228.2485
referencechebi:57303
Image of MNXM1738
InChIKeyUYADDEKIZFRINK-LURJTMIESA-N
InChIInChI=1S/C9H16N4O3/c10-9(11)12-4-1-2-6(8(15)16)13-5-3-7(13)14/h6H,1-5H2,(H,15,16)(H4,10,11,12)/t6-/m0/s1
SMILESNC(=[NH2+])NCCC[C@H](N1CCC1=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref2
Distinct compatimentalized reactions in models0

Similar chemical compounds in external resources
IdentifierDescription
chebi:15426 deoxyamidinoproclavaminic acid
(2S)-5-carbamimidamido-2-(2-oxoazetidin-1-yl)pentanoic acid
DEOXYGUANIDINOPROCLAVAMINIC ACID
Deoxyamidinoproclavaminate
Deoxyguanidinoproclavaminate
Deoxyguanidinoproclavaminic acid
metacycM:DEOXYAMIDINOPROCLAVAMINATE deoxyamidinoproclavaminate
(2S)-5-{[amino(iminio)methyl]amino}-2-(2-oxoazetidin-1-yl)pentanoate
deoxyguanidinoproclavaminate
deoxyguanidinoproclavaminic acid
chebi:57303 deoxyamidinoproclavaminate
(2S)-5-{[amino(iminio)methyl]amino}-2-(2-oxoazetidin-1-yl)pentanoate
deoxyamidinoproclavaminic acid zwitterion
chebi:10791
chebi:14113
chebi:4411
chebi:44845
keggC:M_C06656
seedM:M_cpd04059
secondary/obsolete/fantasy identifier
keggC:C06656 Deoxyguanidinoproclavaminic acid
Deoxyamidinoproclavaminate
Deoxyguanidinoproclavaminate
seedM:cpd04059 Deoxyamidinoproclavaminate
(2S)-5-{[amino(iminio)methyl]amino}-2-(2-oxoazetidin-1-yl)pentanoate
Deoxyguanidinoproclavaminate
Deoxyguanidinoproclavaminic acid
deoxyamidinoproclavaminate
deoxyguanidinoproclavaminate
deoxyguanidinoproclavaminic acid