Feedback

deoxyamidinoproclavaminate

PropertiesImageOccurences in reactions
MNX_IDMNXM1738Image of MNXM1738
#reac
in my sandbox 0
in MNXref (generic)2
in models (compartimentalized) 0
formulaC9H16N4O3
charge0
mass228.2485
referencechebi:57303
InChIKeyUYADDEKIZFRINK-LURJTMIESA-N
InChIInChI=1S/C9H16N4O3/c10-9(11)12-4-1-2-6(8(15)16)13-5-3-7(13)14/h6H,1-5H2,(H,15,16)(H4,10,11,12)/t6-/m0/s1
SMILESNC(=[NH2+])NCCC[C@H](N1CCC1=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:57303
chebi:57303
deoxyamidinoproclavaminate
(2S)-5-{[amino(iminio)methyl]amino}-2-(2-oxoazetidin-1-yl)pentanoate
deoxyamidinoproclavaminic acid zwitterion
seed.compound:cpd04059
seedM:cpd04059
Deoxyamidinoproclavaminate
(2S)-5-{[amino(iminio)methyl]amino}-2-(2-oxoazetidin-1-yl)pentanoate
Deoxyguanidinoproclavaminate
Deoxyguanidinoproclavaminic acid
deoxyamidinoproclavaminate
deoxyguanidinoproclavaminate
deoxyguanidinoproclavaminic acid
kegg.compound:C06656
keggC:C06656
Deoxyguanidinoproclavaminic acid
Deoxyamidinoproclavaminate
Deoxyguanidinoproclavaminate
metacyc.compound:DEOXYAMIDINOPROCLAVAMINATE
metacycM:DEOXYAMIDINOPROCLAVAMINATE
deoxyamidinoproclavaminate
(2S)-5-{[amino(iminio)methyl]amino}-2-(2-oxoazetidin-1-yl)pentanoate
deoxyguanidinoproclavaminate
deoxyguanidinoproclavaminic acid
CHEBI:15426
chebi:15426
deoxyamidinoproclavaminic acid
(2S)-5-carbamimidamido-2-(2-oxoazetidin-1-yl)pentanoic acid
DEOXYGUANIDINOPROCLAVAMINIC ACID
Deoxyamidinoproclavaminate
Deoxyguanidinoproclavaminate
Deoxyguanidinoproclavaminic acid
chebi:10791
chebi:14113
chebi:4411
chebi:44845
keggC:M_C06656
seedM:M_cpd04059
secondary/obsolete/fantasy identifier