Feedback

itaconate

PropertiesImageOccurences in reactions
MNX_IDMNXM1747Image of MNXM1747
#reac
in my sandbox 0
in MNXref (generic)14
in models (compartimentalized) 9
formulaC5H4O4
charge-2
mass128.01206
referencechebi:17240
InChIKeyLVHBHZANLOWSRM-UHFFFAOYSA-L
InChIInChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9)/p-2
SMILESC=C(CC(=O)[O-])C(=O)[O-]
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:17240
chebi:17240
itaconate
2-methylidenebutanedioate
itaconate(2-)
methylenesuccinate(2-)
methylenesuccinic acid, ion(2-)
bigg.metabolite:itacon
biggM:itacon
Itaconate
seed.compound:cpd00380
seedM:cpd00380
Itaconate
2-methylsuccinate
2-propene-1,2-dicarboxylic acid
Itaconic acid
Methylenesuccinic acid
itacon
itaconate
itaconic acid
methylenebutanedioic acid
methylenesuccinic acid
propylenedicarboxylic acid
sabiork.compound:2059
sabiorkM:2059
kegg.compound:C00490
keggC:C00490
Itaconate
Itaconic acid
Methylenesuccinic acid
hmdb:HMDB0002092 Itaconic acid
2-Hydroxy-3-naphthoyl-2-naphthylamine
2-Methylenesuccinate
2-Methylenesuccinic acid
2-Propene-1,2-dicarboxylate
2-Propene-1,2-dicarboxylic acid
2-methylidenebutanedioic acid
Itaconate
Itaconic acid, calcium salt
Itaconic acid, copper salt
Itaconic acid, disodium salt
Itaconic acid, sodium salt
Methylenebutanedioate
Methylenebutanedioic acid
Methylenesuccinate
Methylenesuccinic acid
Propylenedicarboxylate
Propylenedicarboxylic acid
itaconic acid
lipidmaps:LMFA01170063
lipidmapsM:LMFA01170063
Itaconic acid
2-methylenebutanedioic acid
2-methylenesuccinic acid
2-methylidenebutanedioic acid
2-propene-1,2-dicarboxylic acid
FA 5:2
Methylenesuccinic acid
O2
propylenedicarboxylic acid
metacyc.compound:ITACONATE
metacycM:ITACONATE
itaconate
2-methylsuccinate
2-propene-1,2-dicarboxylic acid
itaconic acid
methylenebutanedioic acid
methylenesuccinic acid
propylenedicarboxylic acid
CHEBI:30838
chebi:30838
itaconic acid
2-methylenesuccinic acid
2-methylidenebutanedioic acid
2-propene-1,2-dicarboxylic acid
Itaconic acid
Methylenesuccinic acid
methylenebutanedioic acid
propylenedicarboxylic acid
hmdb:HMDB02092
chebi:14484
chebi:24932
chebi:24933
chebi:6074
biggM:M_itacon
keggC:M_C00490
seedM:M_cpd00380
secondary/obsolete/fantasy identifier