Feedback

itaconate

Properties
MNX_IDMNXM1747
formulaC5H4O4
charge-2
mass128.08286
referencechebi:17240
Image of MNXM1747
InChIKeyLVHBHZANLOWSRM-UHFFFAOYSA-L
InChIInChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h1-2H2,(H,6,7)(H,8,9)/p-2
SMILES[O-]C(=O)CC(=C)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref15
Distinct compatimentalized reactions in models6

Similar chemical compounds in external resources
IdentifierDescription
metacycM:ITACONATE itaconate
2-methylsuccinate
2-propene-1,2-dicarboxylic acid
itaconic acid
methylenebutanedioic acid
methylenesuccinic acid
propylenedicarboxylic acid
lipidmaps:LMFA01170063 Itaconic acid
2-methylenebutanedioic acid
2-methylenesuccinic acid
2-methylidenebutanedioic acid
2-propene-1,2-dicarboxylic acid
Methylenesuccinic acid
propylenedicarboxylic acid
biggM:itacon Itaconate
seedM:cpd00380 Itaconate
2-methylsuccinate
2-propene-1,2-dicarboxylic acid
Itaconic acid
Methylenesuccinic acid
itacon
itaconate
itaconic acid
methylenebutanedioic acid
methylenesuccinic acid
propylenedicarboxylic acid
chebi:17240 itaconate
2-methylidenebutanedioate
itaconate(2-)
methylenesuccinate(2-)
methylenesuccinic acid, ion(2-)
hmdb:HMDB0002092 Itaconic acid
2-Hydroxy-3-naphthoyl-2-naphthylamine
2-Methylenesuccinate
2-Methylenesuccinic acid
2-Propene-1,2-dicarboxylate
2-Propene-1,2-dicarboxylic acid
2-methylidenebutanedioic acid
Itaconate
Itaconic acid, calcium salt
Itaconic acid, copper salt
Itaconic acid, disodium salt
Itaconic acid, sodium salt
Methylenebutanedioate
Methylenebutanedioic acid
Methylenesuccinate
Methylenesuccinic acid
Propylenedicarboxylate
Propylenedicarboxylic acid
itaconic acid
chebi:30838 itaconic acid
2-methylenesuccinic acid
2-methylidenebutanedioic acid
2-propene-1,2-dicarboxylic acid
Itaconic acid
Methylenesuccinic acid
methylenebutanedioic acid
propylenedicarboxylic acid
biggM:M_itacon
chebi:14484
chebi:24932
chebi:24933
chebi:6074
hmdb:HMDB02092
keggC:M_C00490
seedM:M_cpd00380
secondary/obsolete/fantasy identifier
keggC:C00490
sabiorkM:2059
Itaconate
Itaconic acid
Methylenesuccinic acid