Feedback

N-succinyl-L-glutamate

Properties
MNX_IDMNXM1757
formulaC9H10NO7
charge-3
mass244.17824
referencechebi:58763
Image of MNXM1757
InChIKeyJCNBNOQGFSXOML-YFKPBYRVSA-K
InChIInChI=1S/C9H13NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/p-3/t5-/m0/s1
SMILES[O-]C(=O)CC[C@H](NC(=O)CCC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref4
Distinct compatimentalized reactions in models4

Similar chemical compounds in external resources
IdentifierDescription
chebi:58763 N-succinyl-L-glutamate
N-(3-carboxylatopropanoyl)-L-glutamate
N-(3-carboxylatopropanoyl)-L-glutamate(3-)
metacycM:N2-SUCCINYLGLUTAMATE N2-succinylglutamate
N2-Succinyl-L-glutamate
N2-succinylglutamatic acid
N2-succinylglutamic acid
chebi:48957 N(2)-succinyl-L-glutamic acid
(2S)-2-(3-Carboxypropanoylamino)pentanedioic acid
N-(3-carboxy-1-oxopropyl)-L-glutamic acid
N-(3-carboxypropanoyl)-L-glutamic acid
N2-Succinyl-L-glutamate
seedM:cpd03525 N-Succinyl-L-glutamate
(2S)-2-(3-Carboxypropanoylamino)pentanedioic acid
N2-Succinyl-L-glutamate
N2-succinylglutamate
N2-succinylglutamatic acid
N2-succinylglutamic acid
sucglu
biggM:sucglu N2-Succinyl-L-glutamate
biggM:M_sucglu
chebi:21821
chebi:7373
keggC:M_C05931
seedM:M_cpd03525
secondary/obsolete/fantasy identifier
keggC:C05931 N-Succinyl-L-glutamate
(2S)-2-(3-Carboxypropanoylamino)pentanedioic acid
sabiorkM:24572 N2-Succinyl-L-glutamate
N-Succinyl-L-glutamate