Feedback

N-succinyl-L-glutamate

PropertiesImageOccurences in reactions
MNX_IDMNXM1757Image of MNXM1757
#reac
in my sandbox 0
in MNXref (generic)4
in models (compartimentalized) 4
formulaC9H10NO7
charge-3
mass244.17824
referencechebi:58763
InChIKeyJCNBNOQGFSXOML-YFKPBYRVSA-K
InChIInChI=1S/C9H13NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/p-3/t5-/m0/s1
SMILES[O-]C(=O)CC[C@H](NC(=O)CCC([O-])=O)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:58763
chebi:58763
N-succinyl-L-glutamate
N-(3-carboxylatopropanoyl)-L-glutamate
N-(3-carboxylatopropanoyl)-L-glutamate(3-)
CHEBI:48957
chebi:48957
N(2)-succinyl-L-glutamic acid
(2S)-2-(3-Carboxypropanoylamino)pentanedioic acid
N-(3-carboxy-1-oxopropyl)-L-glutamic acid
N-(3-carboxypropanoyl)-L-glutamic acid
N2-Succinyl-L-glutamate
kegg.compound:C05931
keggC:C05931
N-Succinyl-L-glutamate
(2S)-2-(3-Carboxypropanoylamino)pentanedioic acid
seed.compound:cpd03525
seedM:cpd03525
N-Succinyl-L-glutamate
(2S)-2-(3-Carboxypropanoylamino)pentanedioic acid
N2-Succinyl-L-glutamate
N2-succinylglutamate
N2-succinylglutamatic acid
N2-succinylglutamic acid
sucglu
bigg.metabolite:sucglu
biggM:sucglu
N2-Succinyl-L-glutamate
sabiork.compound:24572
sabiorkM:24572
N2-Succinyl-L-glutamate
N-Succinyl-L-glutamate
metacyc.compound:N2-SUCCINYLGLUTAMATE
metacycM:N2-SUCCINYLGLUTAMATE
N2-succinylglutamate
N2-Succinyl-L-glutamate
N2-succinylglutamatic acid
N2-succinylglutamic acid
chebi:21821
chebi:7373
biggM:M_sucglu
keggC:M_C05931
seedM:M_cpd03525
secondary/obsolete/fantasy identifier