Feedback

tetrathionate

PropertiesImageOccurences in reactions
MNX_IDMNXM1781Image of MNXM1781
#reac
in my sandbox 0
in MNXref (generic)33
in models (compartimentalized) 8
formulaO6S4
charge-2
mass224.2604
referencechebi:15226
InChIKeyHPQYKCJIWQFJMS-UHFFFAOYSA-L
InChIInChI=1S/H2O6S4/c1-9(2,3)7-8-10(4,5)6/h(H,1,2,3)(H,4,5,6)/p-2
SMILES[O-]S(=O)(=O)SSS([O-])(=O)=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:15226
chebi:15226
tetrathionate
2,2,5,5-tetraoxido-1,6-dioxy-2,3,4,5-tetrasulfy-[6]catenate(2-)
Tetrathionat
Tetrathionate
[O3SSSSO3](2-)
[S4O6](2-)
bis[(trioxidosulfato)sulfate](S--S)(2-)
disulfanedisulfonate
tetrathionate ion(2-)
tetrathionate(2-)
bigg.metabolite:tet
biggM:tet
envipath:...490c07bb2eac
envipathM:...490c07bb2eac
Tetrathionate
seed.compound:cpd01414
seedM:cpd01414
Tetrathionate
S4O6-2
S4O62-
Tetrathionic acid
tetrathionate
tetrathionic acid
thioperoxydisulfuric acid
tttnt
kegg.compound:C02084
keggC:C02084
Tetrathionate
Tetrathionic acid
CHEBI:33113
chebi:33113
tetrathionate(1-)
3-hydroxytrisulfane-1-sulfonate 3,3-dioxide
hydrogen tetrathionate
metacyc.compound:CPD-14
metacycM:CPD-14
tetrathionate
S4O6-2
S4O62-
tetrathionic acid
thioperoxydisulfuric acid
CHEBI:16853
chebi:16853
tetrathionic acid
1,6-dihydrido-2,2,5,5-tetraoxido-1,6-dioxy-2,3,4,5-tetrasulfy-[6]catena
H2S4O6
Tetrathionic acid
Tetrathionsaeure
[(HO)(O)2SSSS(O)2(OH)]
chebi:9504
biggM:M_tet
keggC:M_C02084
seedM:M_cpd01414
secondary/obsolete/fantasy identifier