Feedback

tetrathionate

Properties
MNX_IDMNXM1781
formulaO6S4
charge-2
mass224.2604
referencechebi:15226
Image of MNXM1781
InChIKeyHPQYKCJIWQFJMS-UHFFFAOYSA-L
InChIInChI=1S/H2O6S4/c1-9(2,3)7-8-10(4,5)6/h(H,1,2,3)(H,4,5,6)/p-2
SMILES[O-]S(=O)(=O)SSS([O-])(=O)=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref33
Distinct compatimentalized reactions in models8

Similar chemical compounds in external resources
IdentifierDescription
chebi:15226 tetrathionate
2,2,5,5-tetraoxido-1,6-dioxy-2,3,4,5-tetrasulfy-[6]catenate(2-)
Tetrathionat
Tetrathionate
[O3SSSSO3](2-)
[S4O6](2-)
bis[(trioxidosulfato)sulfate](S--S)(2-)
disulfanedisulfonate
tetrathionate ion(2-)
tetrathionate(2-)
chebi:33113 tetrathionate(1-)
3-hydroxytrisulfane-1-sulfonate 3,3-dioxide
hydrogen tetrathionate
seedM:cpd01414 Tetrathionate
S4O6-2
S4O62-
Tetrathionic acid
tetrathionate
tetrathionic acid
thioperoxydisulfuric acid
tttnt
chebi:16853 tetrathionic acid
1,6-dihydrido-2,2,5,5-tetraoxido-1,6-dioxy-2,3,4,5-tetrasulfy-[6]catena
H2S4O6
Tetrathionic acid
Tetrathionsaeure
[(HO)(O)2SSSS(O)2(OH)]
keggC:C02084 Tetrathionate
Tetrathionic acid
biggM:tet
envipath:...490c07bb2eac
Tetrathionate
metacycM:CPD-14 tetrathionate
S4O6-2
S4O62-
tetrathionic acid
thioperoxydisulfuric acid
biggM:M_tet
chebi:9504
keggC:M_C02084
seedM:M_cpd01414
secondary/obsolete/fantasy identifier