Feedback

 

1,3-di-(9Z-hexadecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol

Image of MNXM178631
Properties
MNX_IDMNXM178631
formulaC57H100O6
charge0
mass881.4003
referenceslm:000171456
InChIKeyUEJUYCQFKPQPFD-HVEFIRBTSA-N
InChIInChI=1S/C57H100O6/c1-4-7-10-13-16-19-22-25-26-27-28-29-30-33-36-39-42-45-48-51-57(60)63-54(52-61-55(58)49-46-43-40-37-34-31-23-20-17-14-11-8-5-2)53-62-56(59)50-47-44-41-38-35-32-24-21-18-15-12-9-6-3/h16,19-21,23-26,28-29,54H,4-15,17-18,22,27,30-53H2,1-3H3/b19-16-,23-20-,24-21-,26-25-,29-28-
SMILES[H]\C(CCCCCC)=C(/[H])CCCCCCCC(=O)OCC(COC(=O)CCCCCCC\C([H])=C(\[H])CCCCCC)OC(=O)CCCCCCCC\C([H])=C(\[H])C\C([H])=C(\[H])C\C([H])=C(\[H])CCCCC

This chemical compound does not exist in my selection



Occurrences of 1,3-di-(9Z-hexadecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
slm:000171456 1,3-di-(9Z-hexadecenoyl)-2-(10Z,13Z,16Z-docosatrienoyl)-sn-glycerol
TG(16:1(9Z)/22:3(10Z,13Z,16Z)/16:1(9Z))
Triacylglycerol (16:1(9Z)/22:3(10Z,13Z,16Z)/16:1(9Z))