Feedback

 

1,3-dibutyl-7-(2-oxopropyl)purine-2,6-dione

Image of MNXM178707
Properties
MNX_IDMNXM178707
formulaC16H24N4O3
charge0
mass320.3868
referencechebi:92669
InChIKeyHJPRDDKCXVCFOH-UHFFFAOYSA-N
InChIInChI=1S/C16H24N4O3/c1-4-6-8-19-14-13(18(11-17-14)10-12(3)21)15(22)20(16(19)23)9-7-5-2/h11H,4-10H2,1-3H3
SMILESCCCCn1c2ncn(CC(C)=O)c2c(=O)n(CCCC)c1=O

This chemical compound does not exist in my selection



Occurrences of 1,3-dibutyl-7-(2-oxopropyl)purine-2,6-dione in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
chebi:92669 1,3-dibutyl-7-(2-oxopropyl)purine-2,6-dione
HJPRDDKCXVCFOH-UHFFFAOYSA-N