Feedback

2-methyl-cis-aconitate

Properties
MNX_IDMNXM1792
formulaC7H5O6
charge-3
mass185.111
referencechebi:57872
Image of MNXM1792
InChIKeyNUZLRKBHOBPTQV-ARJAWSKDSA-K
InChIInChI=1S/C7H8O6/c1-3(6(10)11)4(7(12)13)2-5(8)9/h2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-3/b4-3-
SMILESC\C(C([O-])=O)=C(/CC([O-])=O)C([O-])=O

Occurences in reactions

#reac
Distinct reactions in my sandbox 0
Distinct generic reactions in MNXref7
Distinct compatimentalized reactions in models3

Similar chemical compounds in external resources
IdentifierDescription
keggC:C04225
sabiorkM:7166
(Z)-But-2-ene-1,2,3-tricarboxylate
cis-2-Methylaconitate
metacycM:CPD-1136 cis-2-methylaconitate
(Z)-but-2-ene-1,2,3-tricarboxylate
2-methyl-cis-aconitate
2-methylaconitate
hmdb:HMDB0006357 cis-2-Methylaconitate
(1Z)-1-methylprop-1-ene-1,2,3-tricarboxylic acid
(2Z)-But-2-ene-1,2,3-tricarboxylic acid
(Z)-2-Butene-1,2,3-tricarboxylic acid
(Z)-But-2-ene-1,2,3-tricarboxylate
(Z)-But-2-ene-1,2,3-tricarboxylic acid
a-Methyl-cis-aconitate
a-Methyl-cis-aconitic acid
a-Methylaconitate
a-Methylaconitic acid
alpha-Methyl-cis-aconitate
alpha-Methyl-cis-aconitic acid
alpha-Methylaconitate
alpha-Methylaconitic acid
alpha-methyl-cis-aconitate
alpha-methyl-cis-aconitic acid
alpha-methylaconitate
alpha-methylaconitic acid
cis-2-Butene-1,2,3-tricarboxylate
cis-2-Butene-1,2,3-tricarboxylic acid
cis-2-Methylaconitic acid
seedM:cpd02597 cis-2-Methylaconitate
(Z)-But-2-ene-1,2,3-tricarboxylate
(Z)-but-2-ene-1,2,3-tricarboxylate
2-methyl-cis-aconitase
2-methyl-cis-aconitate
2-methylaconitate
2mcacn
cis-2-methylaconitate
chebi:16717 (Z)-but-2-ene-1,2,3-tricarboxylic acid
(2Z)-but-2-ene-1,2,3-tricarboxylic acid
(Z)-But-2-ene-1,2,3-tricarboxylate
(Z)-but-2-ene-1,2,3-tricarboxylate
alpha-Methyl-cis-aconitate
alpha-Methylaconitate
cis-2-Butene-1,2,3-tricarboxylic acid
cis-2-Methylaconitate
chebi:57872 2-methyl-cis-aconitate
(1Z)-1-methylprop-1-ene-1,2,3-tricarboxylate
(2Z)-but-2-ene-1,2,3-tricarboxylate
(Z)-but-2-ene-1,2,3-tricarboxylate
biggM:M_2mcacn
chebi:11084
chebi:18819
chebi:456
hmdb:HMDB06357
keggC:M_C04225
seedM:M_cpd02597
secondary/obsolete/fantasy identifier
biggM:2mcacn Cis-2-Methylaconitate