Feedback

2'-hydroxyformononetin

PropertiesImageOccurences in reactions
MNX_IDMNXM1795Image of MNXM1795
#reac
in my sandbox 0
in MNXref (generic)6
in models (compartimentalized) 1
formulaC16H11O5
charge-1
mass283.0612
referencechebi:77687
InChIKeyXKHHKXCBFHUOHM-UHFFFAOYSA-M
InChIInChI=1S/C16H12O5/c1-20-10-3-5-11(14(18)7-10)13-8-21-15-6-9(17)2-4-12(15)16(13)19/h2-8,17-18H,1H3/p-1
SMILESCOc1ccc(-c2coc3cc([O-])ccc3c2=O)c(O)c1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:77687
chebi:77687
2'-hydroxyformononetin
2'-hydroxyformononetin(1-)
3-(2-hydroxy-4-methoxyphenyl)-4-oxo-4H-chromen-7-olate
seed.compound:cpd01868
seedM:cpd01868
2'-Hydroformononetin
2'-Hydroxyformononetin
2-hydroxyformononetin
sabiork.compound:6390
sabiorkM:6390
kegg.compound:C02920
keggC:C02920
2'-Hydroxyformononetin
2'-Hydroformononetin
CHEBI:17678
chebi:17678
2'-hydroxyformononetin
2'-Hydroformononetin
2'-Hydroxyformononetin
7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-chromen-4-one
Xenognosin B
metacyc.compound:2-HYDROXYFORMONONETIN
metacycM:2-HYDROXYFORMONONETIN
2-hydroxyformononetin
hmdb:HMDB0031720 Xenognosin B
2',7-Dihydroxy-4'-methoxyisoflavone
2'-Hydroformononetin
2'-hydroxyformononetin
2-HYDROXYFORMONONETIN
7,2'-Dihydroxy-4'-methoxyisoflavone
7-Hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-chromen-4-one
7-hydroxy-3-(2-hydroxy-4-methoxyphenyl)-4H-chromen-4-one
Xenognosin b
lipidmaps:LMPK12050081
lipidmapsM:LMPK12050081
Xenognosin B
2'-Hydroxyformononetin
hmdb:HMDB31720
chebi:11401
chebi:19268
chebi:843
keggC:M_C02920
seedM:M_cpd01868
secondary/obsolete/fantasy identifier