Feedback

 

3-(3-hydroxyphenyl)-(2E)-propenoate

Image of MNXM1799
Properties
MNX_IDMNXM1799
formulaC9H7O3
charge-1
mass163.1506
referencechebi:47928
InChIKeyKKSDGJDHHZEWEP-SNAWJCMRSA-M
InChIInChI=1S/C9H8O3/c10-8-3-1-2-7(6-8)4-5-9(11)12/h1-6,10H,(H,11,12)/p-1/b5-4+
SMILESOc1cccc(C=CC([O-])=O)c1

This chemical compound does not exist in my selection



Occurrences of 3-(3-hydroxyphenyl)-(2E)-propenoate in the MetaNetX repository

loading...

Similar chemical compounds in external resources
IdentifierDescription
bigg:3hcinnm 3-hydroxycinnamic acid
chebi:32357 (2E)-3-(3-hydroxyphenyl)-2-propenoic acid
(2E)-3-(3-hydroxyphenyl)acrylic acid
(2E)-3-(3-hydroxyphenyl)prop-2-enoic acid
(E)-3-(3-hydroxyphenyl)-2-propenoic acid
3-Coumaric acid
KKSDGJDHHZEWEP-SNAWJCMRSA-N
m-Coumaric acid
m-Hydroxycinnamic acid
trans-3-Hydroxycinnamate
trans-3-Hydroxycinnamic acid
trans-3-coumaric acid
chebi:47925 3-(3-hydroxyphenyl)-2-propenoic acid
3-(3-hydroxyphenyl)acrylic acid
3-(3-hydroxyphenyl)prop-2-enoic acid
3-coumaric acid
3-hydroxycinnamic acid
KKSDGJDHHZEWEP-UHFFFAOYSA-N
m-coumaric acid
m-hydroxycinnamic acid
chebi:47927 3-(3-hydroxyphenyl)acrylate
3-(3-hydroxyphenyl)prop-2-enoate
3-coumarate
KKSDGJDHHZEWEP-UHFFFAOYSA-M
chebi:47928 (2E)-3-(3-hydroxyphenyl)acrylate
(2E)-3-(3-hydroxyphenyl)prop-2-enoate
3-(3-hydroxyphenyl)-(2E)-propenoate
KKSDGJDHHZEWEP-SNAWJCMRSA-M
trans-3-coumarate
hmdb:HMDB62774 3-[(1E)-2-carboxyeth-1-en-1-yl]benzen-1-olate
3-[(1E)-2-carboxyeth-1-en-1-yl]benzenolate
Trans-3-coumarate
kegg:C12621 (2E)-3-(3-Hydroxyphenyl)prop-2-enoate
trans-3-Hydroxycinnamate
metacyc:CPD-10797 (2E)-3-(3-hydroxyphenyl)prop-2-enoate
3-coumarate
3-hydroxy-trans-cinnamate
3-hydroxycinnamate
3-hydroxycinnamic acid
CPD-10797
sabiork:14652 3-Coumaric acid
trans-3-Hydroxycinnamate
sabiork:27751 3-Hydroxycinnamate
seed:cpd09252 3-Coumaric acid
3-hydroxycinnamic acid
3hcinnm
trans-3-Hydroxycinnamate