Feedback

4-chlorophenylacetate

PropertiesImageOccurences in reactions
MNX_IDMNXM1801Image of MNXM1801
#reac
in my sandbox 0
in MNXref (generic)5
in models (compartimentalized) 0
formulaC8H6ClO2
charge-1
mass169.58474
referencechebi:16237
InChIKeyCDPKJZJVTHSESZ-UHFFFAOYSA-M
InChIInChI=1S/C8H7ClO2/c9-7-3-1-6(2-4-7)5-8(10)11/h1-4H,5H2,(H,10,11)/p-1
SMILES[O-]C(=O)Cc1ccc(Cl)cc1
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:16237
chebi:16237
4-chlorophenylacetate
(4-chlorophenyl)acetate
envipath:...e20bf560a879
envipathM:...e20bf560a879
4-Chlorophenylacetate
seed.compound:cpd01972
seedM:cpd01972
4-Chlorophenylacetate
4-Chlorophenyl acetate
4-Chlorophenyl acetic acid
4-Chlorophenylacetic acid
4-chlorophenyl acetate
4-chlorophenyl acetic acid
4-chlorophenylacetate
4-chlorophenylacetic acid
kegg.compound:C03077
keggC:C03077
4-Chlorophenylacetate
4-Chlorophenylacetic acid
metacyc.compound:CPD-1786
metacycM:CPD-1786
4-chlorophenylacetate
4-chlorophenyl acetate
4-chlorophenyl acetic acid
4-chlorophenylacetic acid
CHEBI:30749
chebi:30749
4-chlorophenylacetic acid
(4-chlorophenyl)acetic acid
(p-chlorophenyl)acetic acid
4-Chlorophenylacetic acid
4-chlorobenzeneacetic acid
p-chlorophenylacetic acid
chebi:11975
chebi:11976
chebi:1809
chebi:20342
chebi:20343
keggC:M_C03077
seedM:M_cpd01972
secondary/obsolete/fantasy identifier