Feedback

4-hydroxy-L-threonine

PropertiesImageOccurences in reactions
MNX_IDMNXM1802Image of MNXM1802
#reac
in my sandbox 0
in MNXref (generic)8
in models (compartimentalized) 6
formulaC4H9NO4
charge0
mass135.1186
referencechebi:60904
InChIKeyJBNUARFQOCGDRK-GBXIJSLDSA-N
InChIInChI=1S/C4H9NO4/c5-3(4(8)9)2(7)1-6/h2-3,6-7H,1,5H2,(H,8,9)/t2-,3+/m1/s1
SMILES[NH3+][C@@H]([C@H](O)CO)C([O-])=O
Parent-child relations graph
Deprecated MNXref IDs graph
Similar chemical compounds in external resources
IdentifierDescription
CHEBI:60904
chebi:60904
4-hydroxy-L-threonine
(2S,3S)-2-ammonio-3,4-dihydroxybutanoate
(2S,3S)-2-azaniumyl-3,4-dihydroxybutanoate
4-hydroxy-L-threonine zwitterion
hmdb:HMDB0029389 (+)-threo-2-Amino-3,4-dihydroxybutanoic acid
(+)-threo-Form
2-amino-3,4-Dihydroxybutanoic acid
2-amino-3,4-dihydroxybutanoic acid
lipidmaps:LMFA01050439
lipidmapsM:LMFA01050439
(+)-threo-2-Amino-3,4-dihydroxybutanoic acid
2-amino-3,4-dihydroxybutanoic acid
bigg.metabolite:4hthr
biggM:4hthr
4-Hydroxy-L-threonine
seed.compound:cpd03608
seedM:cpd03608
4-Hydroxy-L-threonine
(2S,3S)-2-amino-3,4-dihydroxybutanoic acid
3-hydroxyhomoserine
4-hydroxy-L-threonine
4hthr
Hydroxythreonine
hydroxythreonine
kegg.compound:C06056
keggC:C06056
4-Hydroxy-L-threonine
Hydroxythreonine
metacyc.compound:CPD0-2189
metacycM:CPD0-2189
4-hydroxy-L-threonine
(2S,3S)-2-amino-3,4-dihydroxybutanoic acid
3-hydroxyhomoserine
hydroxythreonine
CHEBI:28330
chebi:28330
4-hydroxy-L-threonine
(2S,3S)-2-amino-3,4-dihydroxybutanoic acid
4-Hydroxy-L-threonine
hydroxythreonine
hmdb:HMDB29389
chebi:1853
chebi:20393
biggM:M_4hthr
keggC:M_C06056
seedM:M_cpd03608
secondary/obsolete/fantasy identifier